Difference between revisions of "Ec-05 001290"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-05_001290 == * left end position: ** 2464056 * transcription direction: ** NEGATIVE * right end position: ** 2468722 * centisome position: ** 27.0...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-05_001290 == |
− | * | + | * left end position: |
− | ** | + | ** 2464056 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2468722 |
− | * | + | * centisome position: |
− | ** | + | ** 27.067116 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0293_0002 |
− | ** | + | ** Esi0293_0002 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[CARBODEHYDRAT-RXN]] |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: go-term |
− | * [[ | + | * Reaction: [[RXN0-5224]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: go-term | |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-241]] | ||
+ | * [[PWYQT-4429]] | ||
+ | * [[PWY-7117]] | ||
+ | * [[PWY-7115]] | ||
+ | * [[PWY-6142]] | ||
+ | * [[CYANCAT-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2464056}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2468722}} | |
− | + | {{#set: centisome position=27.067116 }} | |
− | + | {{#set: common name=Esi_0293_0002|Esi0293_0002}} | |
− | + | {{#set: reaction associated=CARBODEHYDRAT-RXN|RXN0-5224}} | |
− | + | {{#set: pathway associated=PWY-241|PWYQT-4429|PWY-7117|PWY-7115|PWY-6142|CYANCAT-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:32, 21 March 2018
Gene Ec-05_001290
- left end position:
- 2464056
- transcription direction:
- NEGATIVE
- right end position:
- 2468722
- centisome position:
- 27.067116
- Synonym(s):
- Esi_0293_0002
- Esi0293_0002
Reactions associated
- Reaction: CARBODEHYDRAT-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN0-5224
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome