Difference between revisions of "PWY-5427"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * smiles: ** C2(C=CC1(=C(C(O)=CN1)C=2)) * inchi key: ** InChIKey=PCKPVGOLPK...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5427 PWY-5427] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5427 PWY-5427] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** naphthalene degradation (aerobic) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''6''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[1.2.1.65-RXN]] |
− | * [[RXN- | + | ** 0 associated gene: |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=1.3.1.29-RXN 1.3.1.29-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=NAPHTHALENE-12-DIOXYGENASE-RXN NAPHTHALENE-12-DIOXYGENASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8612 RXN-8612] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8615 RXN-8615] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXNN-386 RXNN-386] | ||
== External links == | == External links == | ||
− | * | + | * UM-BBD-PWY : naph |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=naphthalene degradation (aerobic)}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=6}} | |
− | + | {{#set: completion rate=17.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:32, 21 March 2018
Pathway PWY-5427
- taxonomic range:
- common name:
- naphthalene degradation (aerobic)
- Synonym(s):
Reaction(s) found
1 reactions found over 6 reactions in the full pathway
- 1.2.1.65-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- UM-BBD-PWY : naph