Difference between revisions of "Ec-14 000320"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C=C(C)C=1O)O))C)C * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Ec-14_000320 == * left end position: ** 247828 * transcription direction: ** POSITIVE * right end position: ** 259366 * centisome position: ** 3.7776...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-14_000320 == |
− | * | + | * left end position: |
− | ** | + | ** 247828 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 259366 |
− | * | + | * centisome position: |
− | ** | + | ** 3.7776194 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0029_0049 | ||
+ | ** Esi0029_0049 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.4.25.1-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: automated-name-match | |
− | * | + | == Pathways associated == |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=247828}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=259366}} | |
− | + | {{#set: centisome position=3.7776194 }} | |
− | + | {{#set: common name=Esi_0029_0049|Esi0029_0049}} | |
− | + | {{#set: reaction associated=3.4.25.1-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:32, 21 March 2018
Gene Ec-14_000320
- left end position:
- 247828
- transcription direction:
- POSITIVE
- right end position:
- 259366
- centisome position:
- 3.7776194
- Synonym(s):
- Esi_0029_0049
- Esi0029_0049
Reactions associated
- Reaction: 3.4.25.1-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome