Difference between revisions of "PWY-5268"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] == * smiles: ** CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5268 PWY-5268] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5268 PWY-5268] ==
* smiles:
+
* taxonomic range:
** CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398]
* inchi key:
+
** InChIKey=OLZYNLSKRKFUJC-FPVIQYCMSA-J
+
 
* common name:
 
* common name:
** 3-hydroxy-5-methylhex-4-enoyl-CoA
+
** salvianin biosynthesis
* molecular weight:
+
** 889.657   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''6''' reactions in the full pathway
* [[RXN-11919]]
+
* [[RXN-7828]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Ec-04_004610]]
 +
*** [[Ec-28_003310]]
 +
*** [[Ec-14_000870]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.172-RXN 2.3.1.172-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7997 RXN-7997]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8138 RXN-8138]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8139 RXN-8139]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8140 RXN-8140]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-3398}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986102 50986102]
+
{{#set: common name=salvianin biosynthesis}}
* LIGAND-CPD:
+
{{#set: reaction found=1}}
** [http://www.genome.jp/dbget-bin/www_bget?C16469 C16469]
+
{{#set: total reaction=6}}
* HMDB : HMDB60373
+
{{#set: completion rate=17.0}}
{{#set: smiles=CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=OLZYNLSKRKFUJC-FPVIQYCMSA-J}}
+
{{#set: common name=3-hydroxy-5-methylhex-4-enoyl-CoA}}
+
{{#set: molecular weight=889.657    }}
+
{{#set: produced by=RXN-11919}}
+

Latest revision as of 19:32, 21 March 2018

Pathway PWY-5268

  • taxonomic range:
  • common name:
    • salvianin biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links