Difference between revisions of "SINAPOYL-COA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14388 RXN-14388] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14388 RXN-14388] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=RBFUWESMWRUGFY-GSNIOFLCSA-J
 +
* common name:
 +
** sinapoyl-CoA
 +
* molecular weight:
 +
** 969.7   
 
* Synonym(s):
 
* Synonym(s):
 +
** sinapinoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[CD-SP-2Fe2S-Complex]][c] '''+''' 1 [[FeS-Cluster-Co-Chaperones]][c] '''=>''' 1 [[L-Cysteine-Desulfurases]][c] '''+''' 1 [[Co-chaperone-SP-2Fe2S-Complex]][c]
+
* [[RXN-10919]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 a [cysteine desulfurase]-[scaffold protein-(2Fe-2S)] complex[c] '''+''' 1 an [Fe-S cluster biosynthesis co-chaperone][c] '''=>''' 1 an [L-cysteine desulfurase][c] '''+''' 1 a [co-chaperone]-[scaffold protein-(2Fe-2S)] complex[c]
+
* [[RXN-1124]]
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-7250]], [2Fe-2S] iron-sulfur cluster biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7250 PWY-7250]
+
** '''10''' reactions found over '''10''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: in pathway=PWY-7250}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229225 44229225]
{{#set: reconstruction category=annotation}}
+
* CHEBI:
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57393 57393]
{{#set: reconstruction source=esiliculosus_genome}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00411 C00411]
 +
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
 +
{{#set: inchi key=InChIKey=RBFUWESMWRUGFY-GSNIOFLCSA-J}}
 +
{{#set: common name=sinapoyl-CoA}}
 +
{{#set: molecular weight=969.7    }}
 +
{{#set: common name=sinapinoyl-CoA}}
 +
{{#set: produced by=RXN-10919}}
 +
{{#set: reversible reaction associated=RXN-1124}}

Latest revision as of 19:33, 21 March 2018

Metabolite SINAPOYL-COA

  • smiles:
    • CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
  • inchi key:
    • InChIKey=RBFUWESMWRUGFY-GSNIOFLCSA-J
  • common name:
    • sinapoyl-CoA
  • molecular weight:
    • 969.7
  • Synonym(s):
    • sinapinoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.