Difference between revisions of "PWY-7664"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == * smiles: ** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7664 PWY-7664] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7664 PWY-7664] ==
−
* smiles:
+
* taxonomic range:
−
** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N
+
 
* common name:
 
* common name:
−
** 5'-hydroxycotinine
+
** oleate biosynthesis IV (anaerobic)
−
* molecular weight:
+
−
** 192.217   
+
 
* Synonym(s):
 
* Synonym(s):
−
** allohydroxycotinine
+
** cis-7-hexadecenoate biosynthesis
 +
** cis-9-octadecenoate biosynthesis
 +
** (7Z)-hexadec-7-enoate biosynthesis
 +
** (9Z)-octadec-9-enoate biosynthesis
 +
** (7Z)-hexadecenoate biosynthesis
 +
** (9Z)-octadecenoate biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''10''' reactions found over '''14''' reactions in the full pathway
−
* [[RXN66-163]]
+
* [[RXN-16615]]
−
== Reaction(s) of unknown directionality ==
+
** 4 associated gene(s):
 +
*** [[Ec-27_003480]]
 +
*** [[Ec-27_002090]]
 +
*** [[Ec-12_000640]]
 +
*** [[Ec-12_000650]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-16616]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-16620]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-16621]]
 +
** 4 associated gene(s):
 +
*** [[Ec-12_000650]]
 +
*** [[Ec-12_000640]]
 +
*** [[Ec-27_002090]]
 +
*** [[Ec-27_003480]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-16622]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-16624]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-16625]]
 +
** 4 associated gene(s):
 +
*** [[Ec-12_000650]]
 +
*** [[Ec-12_000640]]
 +
*** [[Ec-27_003480]]
 +
*** [[Ec-27_002090]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-16626]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-16628]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9533]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16614 RXN-16614]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16619 RXN-16619]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16623 RXN-16623]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16627 RXN-16627]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9815515 9815515]
+
{{#set: common name=oleate biosynthesis IV (anaerobic)}}
−
* CHEMSPIDER:
+
{{#set: common name=cis-7-hexadecenoate biosynthesis|cis-9-octadecenoate biosynthesis|(7Z)-hexadec-7-enoate biosynthesis|(9Z)-octadec-9-enoate biosynthesis|(7Z)-hexadecenoate biosynthesis|(9Z)-octadecenoate biosynthesis}}
−
** [http://www.chemspider.com/Chemical-Structure.7991265.html 7991265]
+
{{#set: reaction found=10}}
−
* HMDB : HMDB01427
+
{{#set: total reaction=14}}
−
{{#set: smiles=C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))}}
+
{{#set: completion rate=71.0}}
−
{{#set: inchi key=InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N}}
+
−
{{#set: common name=5'-hydroxycotinine}}
+
−
{{#set: molecular weight=192.217    }}
+
−
{{#set: common name=allohydroxycotinine}}
+
−
{{#set: produced by=RXN66-163}}
+

Latest revision as of 19:33, 21 March 2018

Pathway PWY-7664

  • taxonomic range:
  • common name:
    • oleate biosynthesis IV (anaerobic)
  • Synonym(s):
    • cis-7-hexadecenoate biosynthesis
    • cis-9-octadecenoate biosynthesis
    • (7Z)-hexadec-7-enoate biosynthesis
    • (9Z)-octadec-9-enoate biosynthesis
    • (7Z)-hexadecenoate biosynthesis
    • (9Z)-octadecenoate biosynthesis

Reaction(s) found

10 reactions found over 14 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7664&oldid=27707"