Difference between revisions of "PWY66-4"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16954 CPD-16954] == * smiles: ** CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-332...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16954 CPD-16954] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4] ==
−
* smiles:
+
* taxonomic range:
−
** CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
−
* inchi key:
+
−
** InChIKey=PJDXUYNCNWFPCZ-IUYQGCFVSA-K
+
 
* common name:
 
* common name:
−
** [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate
+
** cholesterol biosynthesis III (via desmosterol)
−
* molecular weight:
+
−
** 380.17   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''9''' reactions found over '''22''' reactions in the full pathway
−
* [[RXN-15733]]
+
* [[PWY-5670]]
−
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
* [[RXN-11887]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_003780]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN66-27]]
 +
** 1 associated gene(s):
 +
*** [[Ec-04_004040]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN66-303]]
 +
** 1 associated gene(s):
 +
*** [[Ec-10_006240]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN66-304]]
 +
** 1 associated gene(s):
 +
*** [[Ec-10_006240]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN66-305]]
 +
** 1 associated gene(s):
 +
*** [[Ec-10_006240]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN66-306]]
 +
** 1 associated gene(s):
 +
*** [[Ec-10_001280]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN66-313]]
 +
** 1 associated gene(s):
 +
*** [[Ec-21_001850]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN66-318]]
 +
** 1 associated gene(s):
 +
*** [[Ec-21_001850]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6132 PWY-6132]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6132 PWY-6132]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-28 RXN66-28]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-310 RXN66-310]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-311 RXN66-311]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-312 RXN66-312]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-314 RXN66-314]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-315 RXN66-315]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-316 RXN66-316]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-317 RXN66-317]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-319 RXN66-319]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-320 RXN66-320]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33208}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657876 90657876]
+
{{#set: common name=cholesterol biosynthesis III (via desmosterol)}}
−
{{#set: smiles=CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))}}
+
{{#set: reaction found=9}}
−
{{#set: inchi key=InChIKey=PJDXUYNCNWFPCZ-IUYQGCFVSA-K}}
+
{{#set: total reaction=22}}
−
{{#set: common name=[1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate}}
+
{{#set: completion rate=41.0}}
−
{{#set: molecular weight=380.17    }}
+
−
{{#set: produced by=RXN-15733}}
+

Latest revision as of 19:33, 21 March 2018

Pathway PWY66-4

  • taxonomic range:
  • common name:
    • cholesterol biosynthesis III (via desmosterol)
  • Synonym(s):

Reaction(s) found

9 reactions found over 22 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY66-4&oldid=27740"