Difference between revisions of "PWY-561"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14018 CPD-14018] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-561 PWY-561] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14018 CPD-14018] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-561 PWY-561] ==
* smiles:
+
* taxonomic range:
** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=JWZLRYCDDXHXDL-LCMHIRPZSA-J
+
 
* common name:
 
* common name:
** icosapentaenoyl-CoA
+
** superpathway of glyoxylate cycle and fatty acid degradation
* molecular weight:
+
** 1047.943   
+
 
* Synonym(s):
 
* Synonym(s):
** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoyl-CoA
 
** (5Z,8Z,11Z,14Z,17Z)-eicosapentaenoyl-CoA
 
** (5Z,8Z,11Z,14Z,17Z)-eicosa-5,8,11,14,17-pentaenoyl-CoA
 
** (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl-CoA
 
** eicosapentaenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-13442]]
+
'''6''' reactions found over '''8''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[FUMHYDR-RXN]]
* [[RXN-12978]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-25_001360]]
* [[RXN-17688]]
+
*** [[Ec-23_003460]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[GLYOXYLATE-BYPASS]]
 +
** 0 associated gene:
 +
* [[MALATE-DEH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-10_006200]]
 +
*** [[Ec-02_003100]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PEPCARBOXYKIN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-19_002930]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PWY-5136]]
 +
** 0 associated gene:
 +
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 +
** 6 associated gene(s):
 +
*** [[Ec-07_007310]]
 +
*** [[Ec-27_006560]]
 +
*** [[Ec-07_002870]]
 +
*** [[Ec-11_000360]]
 +
*** [[Ec-05_003640]]
 +
*** [[Ec-21_003470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* METACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581014 71581014]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=PWY-561 PWY-561]
* CHEBI:
+
{{#set: taxonomic range=TAX-33090}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73862 73862]
+
{{#set: common name=superpathway of glyoxylate cycle and fatty acid degradation}}
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction found=6}}
{{#set: inchi key=InChIKey=JWZLRYCDDXHXDL-LCMHIRPZSA-J}}
+
{{#set: total reaction=8}}
{{#set: common name=icosapentaenoyl-CoA}}
+
{{#set: completion rate=75.0}}
{{#set: molecular weight=1047.943    }}
+
{{#set: common name=(5Z,8Z,11Z,14Z,17Z)-icosapentaenoyl-CoA|(5Z,8Z,11Z,14Z,17Z)-eicosapentaenoyl-CoA|(5Z,8Z,11Z,14Z,17Z)-eicosa-5,8,11,14,17-pentaenoyl-CoA|(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl-CoA|eicosapentaenoyl-CoA}}
+
{{#set: consumed by=RXN-13442}}
+
{{#set: produced by=RXN-12978}}
+
{{#set: reversible reaction associated=RXN-17688}}
+

Latest revision as of 19:33, 21 March 2018

Pathway PWY-561

  • taxonomic range:
  • common name:
    • superpathway of glyoxylate cycle and fatty acid degradation
  • Synonym(s):

Reaction(s) found

6 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links