Difference between revisions of "Ec-01 002340"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEATE-CPD OLEATE-CPD] == * smiles: ** CCCCCCCCC=CCCCCCCCC([O-])=O * inchi key: ** InChIKey=ZQP...") |
(Created page with "Category:Gene == Gene Ec-01_002340 == * left end position: ** 1962618 * transcription direction: ** NEGATIVE * right end position: ** 1967787 * centisome position: ** 19.0...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_002340 == |
− | * | + | * left end position: |
− | ** | + | ** 1962618 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1967787 |
− | * | + | * centisome position: |
− | ** | + | ** 19.019764 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0003_0065 |
− | ** | + | ** Esi0003_0065 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[1.11.1.15-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: go-term | |
− | * [[ | + | * Reaction: [[RXN0-5468]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * | + | *** Assignment: go-term |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=1962618}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1967787}} | |
− | + | {{#set: centisome position=19.019764 }} | |
− | + | {{#set: common name=Esi_0003_0065|Esi0003_0065}} | |
− | + | {{#set: reaction associated=1.11.1.15-RXN|RXN0-5468}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:33, 21 March 2018
Gene Ec-01_002340
- left end position:
- 1962618
- transcription direction:
- NEGATIVE
- right end position:
- 1967787
- centisome position:
- 19.019764
- Synonym(s):
- Esi_0003_0065
- Esi0003_0065
Reactions associated
- Reaction: 1.11.1.15-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN0-5468
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome