Difference between revisions of "CPD-4702"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.8.1.6-RXN 2.8.1.6-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** biotin synthase * ec nu...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.8.1.6-RXN 2.8.1.6-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M
 
* common name:
 
* common name:
** biotin synthase
+
** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/2.8.1.6 EC-2.8.1.6]
+
** 427.646   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN66-318]]
** 2 [[S-ADENOSYLMETHIONINE]][c] '''+''' 2 [[Reduced-2Fe-2S-Ferredoxins]][c] '''+''' 1 [[DETHIOBIOTIN]][c] '''+''' 1 [[Sulfurated-Sulfur-Acceptors]][c] '''=>''' 2 [[CH33ADO]][c] '''+''' 1 [[Unsulfurated-Sulfur-Acceptors]][c] '''+''' 1 [[BIOTIN]][c] '''+''' 2 [[Oxidized-2Fe-2S-Ferredoxins]][c] '''+''' 2 [[MET]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 2 S-adenosyl-L-methionine[c] '''+''' 2 a reduced [2Fe-2S] ferredoxin[c] '''+''' 1 dethiobiotin[c] '''+''' 1 a sulfurated [sulfur carrier][c] '''=>''' 2 5'-deoxyadenosine[c] '''+''' 1 an unsulfurated [sulfur carrier][c] '''+''' 1 biotin[c] '''+''' 2 an oxidized [2Fe-2S] ferredoxin[c] '''+''' 2 L-methionine[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-24_000980]]
+
** ESILICULOSUS_GENOME
+
***GO-TERM
+
== Pathways  ==
+
* [[PWY0-1507]], biotin biosynthesis from 8-amino-7-oxononanoate I: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1507 PWY0-1507]
+
** '''3''' reactions found over '''3''' reactions in the full pathway
+
* [[PWY-7380]], biotin biosynthesis from 8-amino-7-oxononanoate II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7380 PWY-7380]
+
** '''2''' reactions found over '''3''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* PUBCHEM:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22060 22060]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659076 90659076]
* LIGAND-RXN:
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))}}
** [http://www.genome.jp/dbget-bin/www_bget?R01078 R01078]
+
{{#set: inchi key=InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M}}
* UNIPROT:
+
{{#set: common name=4α-carboxy-5α-cholesta-8,24-dien-3β-ol}}
** [http://www.uniprot.org/uniprot/Q9JRW7 Q9JRW7]
+
{{#set: molecular weight=427.646    }}
** [http://www.uniprot.org/uniprot/Q9PLZ3 Q9PLZ3]
+
{{#set: consumed by=RXN66-318}}
** [http://www.uniprot.org/uniprot/P53557 P53557]
+
** [http://www.uniprot.org/uniprot/O67104 O67104]
+
** [http://www.uniprot.org/uniprot/P44987 P44987]
+
** [http://www.uniprot.org/uniprot/Q58692 Q58692]
+
** [http://www.uniprot.org/uniprot/P0A506 P0A506]
+
** [http://www.uniprot.org/uniprot/Q9Z6L5 Q9Z6L5]
+
** [http://www.uniprot.org/uniprot/Q9JUE3 Q9JUE3]
+
** [http://www.uniprot.org/uniprot/P46396 P46396]
+
** [http://www.uniprot.org/uniprot/Q47862 Q47862]
+
** [http://www.uniprot.org/uniprot/P19206 P19206]
+
** [http://www.uniprot.org/uniprot/P32451 P32451]
+
** [http://www.uniprot.org/uniprot/P54967 P54967]
+
** [http://www.uniprot.org/uniprot/P46715 P46715]
+
** [http://www.uniprot.org/uniprot/P73538 P73538]
+
** [http://www.uniprot.org/uniprot/P12996 P12996]
+
** [http://www.uniprot.org/uniprot/O59778 O59778]
+
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=biotin synthase}}
+
{{#set: ec number=EC-2.8.1.6}}
+
{{#set: gene associated=Ec-24_000980}}
+
{{#set: in pathway=PWY0-1507|PWY-7380}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 20:33, 21 March 2018

Metabolite CPD-4702

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))
  • inchi key:
    • InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M
  • common name:
    • 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
  • molecular weight:
    • 427.646
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.