Difference between revisions of "Ec-10 000640"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == * smiles: ** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Ec-10_000640 == * left end position: ** 715343 * transcription direction: ** POSITIVE * right end position: ** 723104 * centisome position: ** 11.003...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-10_000640 == |
− | * | + | * left end position: |
− | ** | + | ** 715343 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 723104 |
− | * | + | * centisome position: |
− | ** | + | ** 11.00361 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0138_0032 |
+ | ** Esi0138_0032 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PROTEIN-KINASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=715343}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=723104}} | |
− | + | {{#set: centisome position=11.00361 }} | |
− | + | {{#set: common name=Esi_0138_0032|Esi0138_0032}} | |
− | {{#set: | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:33, 21 March 2018
Gene Ec-10_000640
- left end position:
- 715343
- transcription direction:
- POSITIVE
- right end position:
- 723104
- centisome position:
- 11.00361
- Synonym(s):
- Esi_0138_0032
- Esi0138_0032
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome