Difference between revisions of "L-PANTOATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5754 PWY-5754] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] == * smiles: ** CC(C)(CO)C(C([O-])=O)O * inchi key: ** InChIKey=OTOIIPJY...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5754 PWY-5754] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** CC(C)(CO)C(C([O-])=O)O
 +
* inchi key:
 +
** InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M
 
* common name:
 
* common name:
** 4-hydroxybenzoate biosynthesis I (eukaryotes)
+
** (R)-pantoate
 +
* molecular weight:
 +
** 147.15   
 
* Synonym(s):
 
* Synonym(s):
** p-hydroxybenzoate biosynthesis I (eukaryotes)
+
** pantoate
 +
** L-pantoate
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''2''' reactions found over '''6''' reactions in the full pathway
+
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
* [[4-COUMARATE--COA-LIGASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** 2 associated gene(s):
+
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
*** [[Ec-04_001280]]
+
== Reaction(s) of unknown directionality ==
*** [[Ec-10_001480]]
+
** 1 reconstruction source(s) associated:
+
*** [[orthology-aragem]]
+
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
+
** 0 associated gene:
+
** 1 reconstruction source(s) associated:
+
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=3.1.2.23-RXN 3.1.2.23-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYPHENYLPYRUVATE-REDUCTASE-RXN HYDROXYPHENYLPYRUVATE-REDUCTASE-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-1118 RXN3O-1118]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-1120 RXN3O-1120]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2759}}
+
* CAS : 470-29-1
{{#set: common name=4-hydroxybenzoate biosynthesis I (eukaryotes)}}
+
* DRUGBANK : DB01930
{{#set: common name=p-hydroxybenzoate biosynthesis I (eukaryotes)}}
+
* PUBCHEM:
{{#set: reaction found=2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5289105 5289105]
{{#set: total reaction=6}}
+
* LIGAND-CPD:
{{#set: completion rate=33.0}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00522 C00522]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.4451134.html 4451134]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15980 15980]
 +
* BIGG : 35240
 +
{{#set: smiles=CC(C)(CO)C(C([O-])=O)O}}
 +
{{#set: inchi key=InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M}}
 +
{{#set: common name=(R)-pantoate}}
 +
{{#set: molecular weight=147.15    }}
 +
{{#set: common name=pantoate|L-pantoate}}
 +
{{#set: consumed by=PANTOATE-BETA-ALANINE-LIG-RXN}}
 +
{{#set: produced by=2-DEHYDROPANTOATE-REDUCT-RXN}}

Latest revision as of 19:34, 21 March 2018

Metabolite L-PANTOATE

  • smiles:
    • CC(C)(CO)C(C([O-])=O)O
  • inchi key:
    • InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M
  • common name:
    • (R)-pantoate
  • molecular weight:
    • 147.15
  • Synonym(s):
    • pantoate
    • L-pantoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(CO)C(C([O-])=O)O" cannot be used as a page name in this wiki.