Difference between revisions of "Ec-18 002200"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15677 CPD-15677] == * smiles: ** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
(Created page with "Category:Gene == Gene Ec-18_002200 == * left end position: ** 2113863 * transcription direction: ** NEGATIVE * right end position: ** 2133598 * centisome position: ** 42.9...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15677 CPD-15677] ==
+
== Gene Ec-18_002200 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2113863
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AFMMIIQKXQNEDN-DUPKWVSKSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 4-trans-undecenoyl-CoA
+
** 2133598
−
* molecular weight:
+
* centisome position:
−
** 929.765    
+
** 42.907513    
 
* Synonym(s):
 
* Synonym(s):
−
** 4E-undecenoyl-CoA
+
** Esi_0053_0056
 +
** Esi0053_0056
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14789]]
+
* Reaction: [[6.3.2.25-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2113863}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658640 90658640]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=2133598}}
−
{{#set: inchi key=InChIKey=AFMMIIQKXQNEDN-DUPKWVSKSA-J}}
+
{{#set: centisome position=42.907513   }}
−
{{#set: common name=4-trans-undecenoyl-CoA}}
+
{{#set: common name=Esi_0053_0056|Esi0053_0056}}
−
{{#set: molecular weight=929.765   }}
+
{{#set: reaction associated=6.3.2.25-RXN}}
−
{{#set: common name=4E-undecenoyl-CoA}}
+
−
{{#set: consumed by=RXN-14789}}
+

Latest revision as of 20:34, 21 March 2018

Gene Ec-18_002200

  • left end position:
    • 2113863
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2133598
  • centisome position:
    • 42.907513
  • Synonym(s):
    • Esi_0053_0056
    • Esi0053_0056

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-18_002200&oldid=27813"