Difference between revisions of "RXN66-27"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-27 RXN66-27] == * direction: ** LEFT-TO-RIGHT * common name: ** Sterol delta-7 reductase * ec...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-27 RXN66-27] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N
+
 
* common name:
 
* common name:
−
** 4,4-dimethyl-5α-cholesta-8-en-3-β-ol
+
** Sterol delta-7 reductase
−
* molecular weight:
+
* ec number:
−
** 414.713   
+
** [http://enzyme.expasy.org/EC/1.3.1.21 EC-1.3.1.21]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN66-14]]
+
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-8646]][c] '''=>''' 1 [[DESMOSTEROL-CPD]][c] '''+''' 1 [[NADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 7-dehydrodesmosterol[c] '''=>''' 1 desmosterol[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-04_004040]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4]
 +
** '''9''' reactions found over '''22''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23427666 23427666]
+
{{#set: common name=Sterol delta-7 reductase}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-1.3.1.21}}
−
** [http://www.chemspider.com/Chemical-Structure.10474091.html 10474091]
+
{{#set: gene associated=Ec-04_004040}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY66-4}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15915 C15915]
+
{{#set: reconstruction category=annotation}}
−
* HMDB : HMDB06840
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N}}
+
−
{{#set: common name=4,4-dimethyl-5α-cholesta-8-en-3-β-ol}}
+
−
{{#set: molecular weight=414.713    }}
+
−
{{#set: produced by=RXN66-14}}
+

Latest revision as of 19:34, 21 March 2018

Reaction RXN66-27

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Sterol delta-7 reductase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NADPH[c] + 1 H+[c] + 1 7-dehydrodesmosterol[c] => 1 desmosterol[c] + 1 NADP+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-4, cholesterol biosynthesis III (via desmosterol): PWY66-4
    • 9 reactions found over 22 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN66-27&oldid=27834"