Difference between revisions of "Ec-27 003730"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] == * smiles: ** C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O) *...")
 
(Created page with "Category:Gene == Gene Ec-27_003730 == * left end position: ** 3283433 * transcription direction: ** NEGATIVE * right end position: ** 3286108 * centisome position: ** 50.9...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] ==
+
== Gene Ec-27_003730 ==
−
* smiles:
+
* left end position:
−
** C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O)
+
** 3283433
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UXOJWGSGKUYMIA-GFCCVEGCSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (S)-equol 4'-sulfate
+
** 3286108
−
* molecular weight:
+
* centisome position:
−
** 321.324    
+
** 50.90667    
 
* Synonym(s):
 
* Synonym(s):
−
** 4',7-isoflavandiol 4'-sulfate
+
** Esi_0000_0494
 +
** Esi0000_0494
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ASPARTATEKIN-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-15589]]
+
*** Assignment: automated-name-match
 +
* Reaction: [[GLUTKIN-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-12002]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[HOMOSERSYN-PWY]]
 +
* [[PWY-7176]]
 +
* [[PROSYN-PWY]]
 +
* [[PWY-7153]]
 +
* [[DAPLYSINESYN-PWY]]
 +
* [[PWY-2942]]
 +
* [[PWY-6922]]
 +
* [[PWY-2941]]
 +
* [[PWY-6559]]
 +
* [[PWY-3341]]
 +
* [[PWY-6562]]
 +
* [[CITRULBIO-PWY]]
 +
* [[PWY-5097]]
 +
* [[ARGININE-SYN4-PWY]]
 +
* [[P101-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3283433}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=29979373 29979373]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O)}}
+
{{#set: right end position=3286108}}
−
{{#set: inchi key=InChIKey=UXOJWGSGKUYMIA-GFCCVEGCSA-M}}
+
{{#set: centisome position=50.90667   }}
−
{{#set: common name=(S)-equol 4'-sulfate}}
+
{{#set: common name=Esi_0000_0494|Esi0000_0494}}
−
{{#set: molecular weight=321.324   }}
+
{{#set: reaction associated=ASPARTATEKIN-RXN|GLUTKIN-RXN|RXN-12002}}
−
{{#set: common name=4',7-isoflavandiol 4'-sulfate}}
+
{{#set: pathway associated=HOMOSERSYN-PWY|PWY-7176|PROSYN-PWY|PWY-7153|DAPLYSINESYN-PWY|PWY-2942|PWY-6922|PWY-2941|PWY-6559|PWY-3341|PWY-6562|CITRULBIO-PWY|PWY-5097|ARGININE-SYN4-PWY|P101-PWY}}
−
{{#set: consumed or produced by=RXN-15589}}
+

Latest revision as of 20:34, 21 March 2018

Gene Ec-27_003730

  • left end position:
    • 3283433
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3286108
  • centisome position:
    • 50.90667
  • Synonym(s):
    • Esi_0000_0494
    • Esi0000_0494

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_003730&oldid=27846"