Difference between revisions of "Ec-12 007760"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XYLULOSE-5-PHOSPHATE XYLULOSE-5-PHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-])C(O)C(O)C(=O)CO *...") |
(Created page with "Category:Gene == Gene Ec-12_007760 == * Synonym(s): ** Esi_0159_0029 ** Esi0159_0029 == Reactions associated == * Reaction: RXN-1884 ** Source: orthology-aragem =...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_007760 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0159_0029 |
− | ** | + | ** Esi0159_0029 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-1884]] | |
− | + | ** Source: [[orthology-aragem]] | |
− | + | == Pathways associated == | |
− | + | * [[PWY-882]] | |
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0159_0029|Esi0159_0029}} | |
− | + | {{#set: reaction associated=RXN-1884}} | |
− | + | {{#set: pathway associated=PWY-882}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:34, 21 March 2018
Gene Ec-12_007760
- Synonym(s):
- Esi_0159_0029
- Esi0159_0029
Reactions associated
- Reaction: RXN-1884
- Source: orthology-aragem