Difference between revisions of "RXN1F-461"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE-5P PYRIDOXAMINE-5P] == * smiles: ** CC1(C(=C(C(COP([O-])([O-])=O)=CN=1)C[N+])O) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-461 RXN1F-461] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-461 RXN1F-461] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.1.91 EC-2.4.1.91] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[CPD-12575]][c] '''+''' 1 [[CPD1F-90]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD1F-453]][c] '''+''' 1 [[UDP]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 UDP-α-D-glucose[c] '''+''' 1 kaempferol[c] '''=>''' 1 H+[c] '''+''' 1 kaempferol-3-glucoside[c] '''+''' 1 UDP[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-14_000870]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-04_004610]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7143]], kaempferol gentiobioside biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7143 PWY-7143] | ||
+ | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
+ | * [[PWY-5320]], kaempferol glycoside biosynthesis (Arabidopsis): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5320 PWY-5320] | ||
+ | ** '''1''' reactions found over '''11''' reactions in the full pathway | ||
+ | * [[PWY-5348]], kaempferol triglucoside biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5348 PWY-5348] | ||
+ | ** '''1''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-7168]]: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7168 PWY-7168] | ||
+ | ** '''1''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-2.4.1.91}} | |
− | + | {{#set: gene associated=Ec-14_000870|Ec-04_004610}} | |
− | + | {{#set: in pathway=PWY-7143|PWY-5320|PWY-5348|PWY-7168}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-aragem}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:35, 21 March 2018
Contents
Reaction RXN1F-461
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 UDP-α-D-glucose[c] + 1 kaempferol[c] => 1 H+[c] + 1 kaempferol-3-glucoside[c] + 1 UDP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-14_000870
- Source: orthology-aragem
- Gene: Ec-04_004610
- Source: orthology-aragem
Pathways
- PWY-7143, kaempferol gentiobioside biosynthesis: PWY-7143
- 1 reactions found over 2 reactions in the full pathway
- PWY-5320, kaempferol glycoside biosynthesis (Arabidopsis): PWY-5320
- 1 reactions found over 11 reactions in the full pathway
- PWY-5348, kaempferol triglucoside biosynthesis: PWY-5348
- 1 reactions found over 4 reactions in the full pathway
- PWY-7168: PWY-7168
- 1 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem