Difference between revisions of "RXN-14107"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14107 RXN-14107] == * direction: ** LEFT-TO-RIGHT * common name: ** menaquinol-cytochrome c red...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14107 RXN-14107] ==
−
* smiles:
+
* direction:
−
** CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J
+
 
* common name:
 
* common name:
−
** linoleoyl-CoA
+
** menaquinol-cytochrome c reductase
−
* molecular weight:
+
** Cytochrome c1
−
** 1025.937   
+
** ubiquinol cytochrome c reductase subunit QCR9
 +
** Ubiquinol cytochrome reductase, transmembrane domain
 +
** Ubiquinol-cytochrome C reductase hinge domain
 +
** Cytochrome b-c1 complex subunit 7
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.10.2.2 EC-1.10.2.2]
 
* Synonym(s):
 
* Synonym(s):
−
** cis,cis-octadeca-9,12-dienoyl-CoA
+
** menaquinone:cytochrome c reductase
−
** (9Z,12Z)-octadeca-9,12-dienoyl-CoA
+
−
** 18:2(n-6)
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[1.14.19.3-RXN]]
+
* With identifiers:
−
* [[RXN-16094]]
+
** 2 [[Cytochromes-C-Oxidized]][e] '''+''' 1 [[Menaquinols]][c] '''=>''' 2 [[Cytochromes-C-Reduced]][e] '''+''' 2 [[PROTON]][c] '''+''' 1 [[Menaquinones]][c]
−
* [[LINOLEOYL-RXN]]
+
* With common name(s):
−
== Reaction(s) known to produce the compound ==
+
** 2 an oxidized c-type cytochrome[e] '''+''' 1 a menaquinol[c] '''=>''' 2 a reduced c-type cytochrome[e] '''+''' 2 H+[c] '''+''' 1 a menaquinone[c]
−
* [[RXN-16045]]
+
 
−
* [[RXN-9601]]
+
== Genes associated with this reaction  ==
−
* [[RXN-9673]]
+
Genes have been associated with this reaction based on different elements listed below.
−
== Reaction(s) of unknown directionality ==
+
* Gene: [[Ec-21_004500]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-18_002810]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-01_002540]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-25_001440]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-08_003040]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245440 25245440]
+
{{#set: common name=menaquinol-cytochrome c reductase}}
−
* CHEBI:
+
{{#set: common name=Cytochrome c1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57383 57383]
+
{{#set: common name=ubiquinol cytochrome c reductase subunit QCR9}}
−
* LIGAND-CPD:
+
{{#set: common name=Ubiquinol cytochrome reductase, transmembrane domain}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02050 C02050]
+
{{#set: common name=Ubiquinol-cytochrome C reductase hinge domain}}
−
* HMDB : HMDB01064
+
{{#set: common name=Cytochrome b-c1 complex subunit 7}}
−
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: ec number=EC-1.10.2.2}}
−
{{#set: inchi key=InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J}}
+
{{#set: common name=menaquinone:cytochrome c reductase}}
−
{{#set: common name=linoleoyl-CoA}}
+
{{#set: gene associated=Ec-21_004500|Ec-18_002810|Ec-01_002540|Ec-25_001440|Ec-08_003040}}
−
{{#set: molecular weight=1025.937    }}
+
{{#set: in pathway=}}
−
{{#set: common name=cis,cis-octadeca-9,12-dienoyl-CoA|(9Z,12Z)-octadeca-9,12-dienoyl-CoA|18:2(n-6)}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: consumed by=1.14.19.3-RXN|RXN-16094|LINOLEOYL-RXN}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: produced by=RXN-16045|RXN-9601|RXN-9673}}
+
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:35, 21 March 2018

Reaction RXN-14107

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • menaquinol-cytochrome c reductase
    • Cytochrome c1
    • ubiquinol cytochrome c reductase subunit QCR9
    • Ubiquinol cytochrome reductase, transmembrane domain
    • Ubiquinol-cytochrome C reductase hinge domain
    • Cytochrome b-c1 complex subunit 7
  • ec number:
  • Synonym(s):
    • menaquinone:cytochrome c reductase

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-14107&oldid=28000"