Difference between revisions of "2.3.1.23-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.23-RXN 2.3.1.23-RXN] == * direction: ** REVERSIBLE * common name: ** Lyso-phosphatidylcholine...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.23-RXN 2.3.1.23-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Lyso-phosphatidylcholine acyltransferase |
− | * | + | ** Tafazzin |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/2.3.1.23 EC-2.3.1.23] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[2-Lysophosphatidylcholines]][c] '''+''' 1 [[ACYL-COA]][c] '''<=>''' 1 [[PHOSPHATIDYLCHOLINE]][c] '''+''' 1 [[CO-A]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 a 1-acyl-sn-glycero-3-phosphocholine[c] '''+''' 1 an acyl-CoA[c] '''<=>''' 1 a phosphatidylcholine[c] '''+''' 1 coenzyme A[c] |
− | == | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-16_002160]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-27_004770]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-6803]], phosphatidylcholine acyl editing: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6803 PWY-6803] | ||
+ | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-7470]], phosphatidylcholine biosynthesis VII: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7470 PWY-7470] | ||
+ | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12937 12937] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01318 R01318] |
− | + | {{#set: direction=REVERSIBLE}} | |
− | {{#set: | + | {{#set: common name=Lyso-phosphatidylcholine acyltransferase}} |
− | {{#set: | + | {{#set: common name=Tafazzin}} |
− | {{#set: common name= | + | {{#set: ec number=EC-2.3.1.23}} |
− | {{#set: | + | {{#set: gene associated=Ec-16_002160|Ec-27_004770}} |
− | {{#set: | + | {{#set: in pathway=PWY-6803|PWY-7470}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:35, 21 March 2018
Contents
Reaction 2.3.1.23-RXN
- direction:
- REVERSIBLE
- common name:
- Lyso-phosphatidylcholine acyltransferase
- Tafazzin
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 2-Lysophosphatidylcholines[c] + 1 ACYL-COA[c] <=> 1 PHOSPHATIDYLCHOLINE[c] + 1 CO-A[c]
- With common name(s):
- 1 a 1-acyl-sn-glycero-3-phosphocholine[c] + 1 an acyl-CoA[c] <=> 1 a phosphatidylcholine[c] + 1 coenzyme A[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-16_002160
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-27_004770
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY-6803, phosphatidylcholine acyl editing: PWY-6803
- 3 reactions found over 4 reactions in the full pathway
- PWY-7470, phosphatidylcholine biosynthesis VII: PWY-7470
- 1 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links