Difference between revisions of "POLYAMINSYN3-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTIDINE CYTIDINE] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))O * inchi key: ** InC...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=POLYAMINSYN3-PWY POLYAMINSYN3-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=POLYAMINSYN3-PWY POLYAMINSYN3-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** superpathway of polyamine biosynthesis II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** polyamn | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''4''' reactions found over '''7''' reactions in the full pathway |
− | * [[ | + | * [[BSUBPOLYAMSYN-PWY]] |
− | + | ** 0 associated gene: | |
− | * [[ | + | * [[PWY-43]] |
− | == Reaction(s) | + | ** 0 associated gene: |
+ | * [[PWY-46]] | ||
+ | ** 0 associated gene: | ||
+ | * [[SPERMINE-SYNTHASE-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-04_002790]] | ||
+ | *** [[Ec-17_001590]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=POLYAMINSYN3-PWY POLYAMINSYN3-PWY] | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | ** [http:// | + | {{#set: common name=superpathway of polyamine biosynthesis II}} |
− | + | {{#set: common name=polyamn}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=57.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:35, 21 March 2018
Pathway POLYAMINSYN3-PWY
- taxonomic range:
- common name:
- superpathway of polyamine biosynthesis II
- Synonym(s):
- polyamn
Reaction(s) found
4 reactions found over 7 reactions in the full pathway
- BSUBPOLYAMSYN-PWY
- 0 associated gene:
- PWY-43
- 0 associated gene:
- PWY-46
- 0 associated gene:
- SPERMINE-SYNTHASE-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: