Difference between revisions of "Ec-16 004700"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == * smiles: ** CC(C)=CCSCC([N+])C(=O)[O-] * inchi key...") |
(Created page with "Category:Gene == Gene Ec-16_004700 == * left end position: ** 4801309 * transcription direction: ** POSITIVE * right end position: ** 4805578 * centisome position: ** 89.9...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-16_004700 == |
− | * | + | * left end position: |
− | ** | + | ** 4801309 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4805578 |
− | * | + | * centisome position: |
− | ** | + | ** 89.95167 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0164_0059 |
+ | ** Esi0164_0059 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[CARBODEHYDRAT-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | * Reaction: [[RXN0-5224]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY-241]] | ||
+ | * [[PWYQT-4429]] | ||
+ | * [[PWY-7117]] | ||
+ | * [[PWY-7115]] | ||
+ | * [[PWY-6142]] | ||
+ | * [[CYANCAT-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4801309}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4805578}} | |
− | + | {{#set: centisome position=89.95167 }} | |
− | + | {{#set: common name=Esi_0164_0059|Esi0164_0059}} | |
− | + | {{#set: reaction associated=CARBODEHYDRAT-RXN|RXN0-5224}} | |
− | + | {{#set: pathway associated=PWY-241|PWYQT-4429|PWY-7117|PWY-7115|PWY-6142|CYANCAT-PWY}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:35, 21 March 2018
Gene Ec-16_004700
- left end position:
- 4801309
- transcription direction:
- POSITIVE
- right end position:
- 4805578
- centisome position:
- 89.95167
- Synonym(s):
- Esi_0164_0059
- Esi0164_0059
Reactions associated
- Reaction: CARBODEHYDRAT-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN0-5224
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome