Difference between revisions of "S-PRENYL-L-CYSTEINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5169 CPD-5169] == * common name: ** a glucosyl-(mannosyl)9-(N-acetylglucosaminyl)2-diphosph...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == * smiles: ** CC(C)=CCSCC([N+])C(=O)[O-] * inchi key...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == |
+ | * smiles: | ||
+ | ** CC(C)=CCSCC([N+])C(=O)[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** S-prenyl-L-cysteine |
+ | * molecular weight: | ||
+ | ** 189.272 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** prenyl-L-cysteine |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.8.3.5-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200435 25200435] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47914 47914] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C06751 C06751] | ||
+ | * HMDB : HMDB12286 | ||
+ | {{#set: smiles=CC(C)=CCSCC([N+])C(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N}} | ||
+ | {{#set: common name=S-prenyl-L-cysteine}} | ||
+ | {{#set: molecular weight=189.272 }} | ||
+ | {{#set: common name=prenyl-L-cysteine}} | ||
+ | {{#set: consumed by=1.8.3.5-RXN}} |
Latest revision as of 19:35, 21 March 2018
Contents
Metabolite S-PRENYL-L-CYSTEINE
- smiles:
- CC(C)=CCSCC([N+])C(=O)[O-]
- inchi key:
- InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N
- common name:
- S-prenyl-L-cysteine
- molecular weight:
- 189.272
- Synonym(s):
- prenyl-L-cysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCSCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.