Difference between revisions of "Ec-25 001860"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROPHOSPHOGLYCEROL GLYCEROPHOSPHOGLYCEROL] == * smiles: ** C(C(COP(OCC(CO)O)([O-])=O)O)O *...") |
(Created page with "Category:Gene == Gene Ec-25_001860 == * left end position: ** 2157913 * transcription direction: ** NEGATIVE * right end position: ** 2173608 * centisome position: ** 48.4...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-25_001860 == |
− | * | + | * left end position: |
− | ** | + | ** 2157913 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2173608 |
− | * | + | * centisome position: |
− | ** | + | ** 48.48221 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0116_0046 |
− | ** | + | ** Esi0116_0046 |
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[ATPSYN-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
+ | * [[PWY-7219]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2157913}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2173608}} | |
− | + | {{#set: centisome position=48.48221 }} | |
− | + | {{#set: common name=Esi_0116_0046|Esi0116_0046}} | |
− | + | {{#set: reaction associated=ATPSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7219}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:36, 21 March 2018
Gene Ec-25_001860
- left end position:
- 2157913
- transcription direction:
- NEGATIVE
- right end position:
- 2173608
- centisome position:
- 48.48221
- Synonym(s):
- Esi_0116_0046
- Esi0116_0046
Reactions associated
- Reaction: ATPSYN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome