Difference between revisions of "Ec-26 005690"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC...")
(Created page with "Category:Gene == Gene Ec-26_005690 == * left end position: ** 5845448 * transcription direction: ** NEGATIVE * right end position: ** 5854282 * centisome position: ** 88.7...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] ==
+
== Gene Ec-26_005690 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C
+
** 5845448
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 5α-cholesta-8-en-3-one
+
** 5854282
−
* molecular weight:
+
* centisome position:
−
** 384.644    
+
** 88.79142    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0059_0103
 +
** Esi0059_0103
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.4.21.92-RXN]]
−
* [[RXN66-23]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5845448}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203379 25203379]
+
{{#set: transcription direction=NEGATIVE}}
−
* HMDB : HMDB12178
+
{{#set: right end position=5854282}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C}}
+
{{#set: centisome position=88.79142    }}
−
{{#set: inchi key=InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N}}
+
{{#set: common name=Esi_0059_0103|Esi0059_0103}}
−
{{#set: common name=5α-cholesta-8-en-3-one}}
+
{{#set: reaction associated=3.4.21.92-RXN}}
−
{{#set: molecular weight=384.644    }}
+
−
{{#set: produced by=RXN66-23}}
+

Latest revision as of 19:36, 21 March 2018

Gene Ec-26_005690

  • left end position:
    • 5845448
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5854282
  • centisome position:
    • 88.79142
  • Synonym(s):
    • Esi_0059_0103
    • Esi0059_0103

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-26_005690&oldid=28048"