Difference between revisions of "CPD-13188"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4341 PWY-4341] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13188 CPD-13188] == * smiles: ** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4341 PWY-4341] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13188 CPD-13188] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O))
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
+
* inchi key:
 +
** InChIKey=CWVRQJBCBCTFLT-XXFCETQUSA-N
 
* common name:
 
* common name:
** L-glutamate biosynthesis V
+
** β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp
 +
* molecular weight:
 +
** 488.442   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''1''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
+
* [[RXN-12270]]
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
* '''0''' reaction(s) not found
+
 
== External links  ==
 
== External links  ==
* ARACYC:
+
* LIGAND-CPD:
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-4341 PWY-4341]
+
** [http://www.genome.jp/dbget-bin/www_bget?C19966 C19966]
{{#set: taxonomic range=TAX-33090}}
+
* CHEBI:
{{#set: taxonomic range=TAX-1117}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63259 63259]
{{#set: common name=L-glutamate biosynthesis V}}
+
* PUBCHEM:
{{#set: reaction found=1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940204 52940204]
{{#set: reaction not found=0}}
+
{{#set: smiles=CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O))}}
 +
{{#set: inchi key=InChIKey=CWVRQJBCBCTFLT-XXFCETQUSA-N}}
 +
{{#set: common name=β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp}}
 +
{{#set: molecular weight=488.442    }}
 +
{{#set: produced by=RXN-12270}}

Latest revision as of 20:36, 21 March 2018

Metabolite CPD-13188

  • smiles:
    • CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O))
  • inchi key:
    • InChIKey=CWVRQJBCBCTFLT-XXFCETQUSA-N
  • common name:
    • β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp
  • molecular weight:
    • 488.442
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links