Difference between revisions of "CPD-13188"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4341 PWY-4341] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13188 CPD-13188] == * smiles: ** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13188 CPD-13188] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O)) |
| − | ** | + | * inchi key: |
| + | ** InChIKey=CWVRQJBCBCTFLT-XXFCETQUSA-N | ||
* common name: | * common name: | ||
| − | ** L- | + | ** β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp |
| + | * molecular weight: | ||
| + | ** 488.442 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-12270]] | |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-CPD: |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19966 C19966] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63259 63259] |
| − | {{#set: common name=L- | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940204 52940204] |
| − | {{#set: | + | {{#set: smiles=CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O))}} |
| + | {{#set: inchi key=InChIKey=CWVRQJBCBCTFLT-XXFCETQUSA-N}} | ||
| + | {{#set: common name=β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp}} | ||
| + | {{#set: molecular weight=488.442 }} | ||
| + | {{#set: produced by=RXN-12270}} | ||
Latest revision as of 19:36, 21 March 2018
Contents
Metabolite CPD-13188
- smiles:
- CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O))
- inchi key:
- InChIKey=CWVRQJBCBCTFLT-XXFCETQUSA-N
- common name:
- β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp
- molecular weight:
- 488.442
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
