Difference between revisions of "GLY3KIN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-PHOSPHONOOXY-THREONINE 4-PHOSPHONOOXY-THREONINE] == * smiles: ** C(=O)([O-])C([N+])C(O)COP([O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLY3KIN-RXN GLY3KIN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Glycerate 3-kinase * ec...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-PHOSPHONOOXY-THREONINE 4-PHOSPHONOOXY-THREONINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLY3KIN-RXN GLY3KIN-RXN] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])C([N+])C(O)COP([O-])(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=FKHAKIJOKDGEII-GBXIJSLDSA-L
+
 
* common name:
 
* common name:
−
** 4-phospho-hydroxy-L-threonine
+
** Glycerate 3-kinase
−
* molecular weight:
+
* ec number:
−
** 213.083   
+
** [http://enzyme.expasy.org/EC/2.7.1.31 EC-2.7.1.31]
 
* Synonym(s):
 
* Synonym(s):
−
** L-threo-3-hydroxy-homoserine phosphate
 
−
** 4-phosphonooxy-L-threonine
 
−
** 4-phospho-hydroxy-threonine
 
−
** 4-(phosphonooxy)-threonine
 
−
** O-phospho-4-hydroxy-L-threonine
 
−
** phospho-hydroxy-threonine
 
−
** 4-(phosphonooxy)-L-threonine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14125]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[GLYCERATE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[G3P]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[PSERTRANSAMPYR-RXN]]
+
** 1 D-glycerate[c] '''+''' 1 ATP[c] '''=>''' 1 ADP[c] '''+''' 1 3-phospho-D-glycerate[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-11_001840]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-181]], photorespiration: [http://metacyc.org/META/NEW-IMAGE?object=PWY-181 PWY-181]
 +
** '''6''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* RHEA:
−
** [http://www.genome.jp/dbget-bin/www_bget?C06055 C06055]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23516 23516]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58452 58452]
+
** [http://www.genome.jp/dbget-bin/www_bget?R01514 R01514]
−
* BIGG : 1448859
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=Glycerate 3-kinase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480653 45480653]
+
{{#set: ec number=EC-2.7.1.31}}
−
* HMDB : HMDB06802
+
{{#set: gene associated=Ec-11_001840}}
−
{{#set: smiles=C(=O)([O-])C([N+])C(O)COP([O-])(=O)[O-]}}
+
{{#set: in pathway=PWY-181}}
−
{{#set: inchi key=InChIKey=FKHAKIJOKDGEII-GBXIJSLDSA-L}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=4-phospho-hydroxy-L-threonine}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: molecular weight=213.083    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=L-threo-3-hydroxy-homoserine phosphate|4-phosphonooxy-L-threonine|4-phospho-hydroxy-threonine|4-(phosphonooxy)-threonine|O-phospho-4-hydroxy-L-threonine|phospho-hydroxy-threonine|4-(phosphonooxy)-L-threonine}}
+
−
{{#set: consumed by=RXN-14125}}
+
−
{{#set: reversible reaction associated=PSERTRANSAMPYR-RXN}}
+

Latest revision as of 20:36, 21 March 2018

Reaction GLY3KIN-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Glycerate 3-kinase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 D-glycerate[c] + 1 ATP[c] => 1 ADP[c] + 1 3-phospho-D-glycerate[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-181, photorespiration: PWY-181
    • 6 reactions found over 9 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GLY3KIN-RXN&oldid=28079"