Difference between revisions of "Ec-07 006660"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18490 CPD-18490] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
 
(Created page with "Category:Gene == Gene Ec-07_006660 == * left end position: ** 6407130 * transcription direction: ** POSITIVE * right end position: ** 6413630 * centisome position: ** 82.9...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18490 CPD-18490] ==
+
== Gene Ec-07_006660 ==
−
* smiles:
+
* left end position:
−
** CCCCCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 6407130
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AVRCOFDAWHWKMB-MNTHWFIHSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (2E,9Z,12Z,15Z,18Z)-tetracosa-2,9,12,15,18-pentaenoyl-CoA
+
** 6413630
−
* molecular weight:
+
* centisome position:
−
** 1104.05    
+
** 82.9678    
 
* Synonym(s):
 
* Synonym(s):
−
** (2E,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA
+
** Esi_0110_0075
 +
** Esi0110_0075
 +
** PKS
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17111]]
+
* Reaction: [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-aragem]]
−
* [[RXN-17110]]
+
* Reaction: [[RXN-10734]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-7645]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-5059]]
 +
* [[PWY1F-FLAVSYN]]
 +
* [[PWY-6787]]
 +
* [[PWY-7397]]
 +
* [[PWY-6316]]
 +
* [[PWY-5135]]
 +
* [[PWY-6312]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: left end position=6407130}}
−
{{#set: inchi key=InChIKey=AVRCOFDAWHWKMB-MNTHWFIHSA-J}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=(2E,9Z,12Z,15Z,18Z)-tetracosa-2,9,12,15,18-pentaenoyl-CoA}}
+
{{#set: right end position=6413630}}
−
{{#set: molecular weight=1104.05   }}
+
{{#set: centisome position=82.9678   }}
−
{{#set: common name=(2E,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA}}
+
{{#set: common name=Esi_0110_0075|Esi0110_0075|PKS}}
−
{{#set: consumed by=RXN-17111}}
+
{{#set: reaction associated=NARINGENIN-CHALCONE-SYNTHASE-RXN|RXN-10734|RXN-7645}}
−
{{#set: produced by=RXN-17110}}
+
{{#set: pathway associated=PWY-5059|PWY1F-FLAVSYN|PWY-6787|PWY-7397|PWY-6316|PWY-5135|PWY-6312}}

Latest revision as of 19:36, 21 March 2018

Gene Ec-07_006660

  • left end position:
    • 6407130
  • transcription direction:
    • POSITIVE
  • right end position:
    • 6413630
  • centisome position:
    • 82.9678
  • Synonym(s):
    • Esi_0110_0075
    • Esi0110_0075
    • PKS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-07_006660&oldid=28093"