Difference between revisions of "CPD-18490"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-27_002900 == * left end position: ** 2561423 * transcription direction: ** POSITIVE * right end position: ** 2568339 * centisome position: ** 39.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18490 CPD-18490] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18490 CPD-18490] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=AVRCOFDAWHWKMB-MNTHWFIHSA-J |
| − | * | + | * common name: |
| − | ** | + | ** (2E,9Z,12Z,15Z,18Z)-tetracosa-2,9,12,15,18-pentaenoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1104.05 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (2E,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA |
| − | + | ||
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-17111]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-17110]] |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=AVRCOFDAWHWKMB-MNTHWFIHSA-J}} |
| − | {{#set: | + | {{#set: common name=(2E,9Z,12Z,15Z,18Z)-tetracosa-2,9,12,15,18-pentaenoyl-CoA}} |
| − | {{#set: | + | {{#set: molecular weight=1104.05 }} |
| − | {{#set: common name= | + | {{#set: common name=(2E,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA}} |
| − | {{#set: | + | {{#set: consumed by=RXN-17111}} |
| + | {{#set: produced by=RXN-17110}} | ||
Latest revision as of 19:36, 21 March 2018
Contents
Metabolite CPD-18490
- smiles:
- CCCCCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=AVRCOFDAWHWKMB-MNTHWFIHSA-J
- common name:
- (2E,9Z,12Z,15Z,18Z)-tetracosa-2,9,12,15,18-pentaenoyl-CoA
- molecular weight:
- 1104.05
- Synonym(s):
- (2E,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.
