Difference between revisions of "CPD-12853"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR] == * smiles: ** C(C2(C(O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] == |
* smiles: | * smiles: | ||
− | ** C(C2(C( | + | ** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34)))) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N |
* common name: | * common name: | ||
− | ** | + | ** 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 396.655 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)- |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-11881]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986075 50986075] |
− | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}} | |
− | + | {{#set: inchi key=InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N}} | |
− | + | {{#set: common name=4α-methyl-5α-cholesta-8,14,24-trien-3β-ol}} | |
− | + | {{#set: molecular weight=396.655 }} | |
− | + | {{#set: common name=cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-}} | |
− | {{#set: smiles=C(C2(C( | + | {{#set: produced by=RXN-11881}} |
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:36, 21 March 2018
Contents
Metabolite CPD-12853
- smiles:
- CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N
- common name:
- 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol
- molecular weight:
- 396.655
- Synonym(s):
- cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.