Difference between revisions of "CPD-12853"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-20_001950 == * left end position: ** 1928474 * transcription direction: ** NEGATIVE * right end position: ** 1932140 * centisome position: ** 37.3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N |
| − | * | + | * common name: |
| − | ** | + | ** 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol |
| − | * | + | * molecular weight: |
| − | ** | + | ** 396.655 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)- |
| − | + | ||
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-11881]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986075 50986075] |
| − | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N}} |
| − | {{#set: common name= | + | {{#set: common name=4α-methyl-5α-cholesta-8,14,24-trien-3β-ol}} |
| − | + | {{#set: molecular weight=396.655 }} | |
| − | {{#set: | + | {{#set: common name=cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-}} |
| + | {{#set: produced by=RXN-11881}} | ||
Latest revision as of 20:36, 21 March 2018
Contents
Metabolite CPD-12853
- smiles:
- CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N
- common name:
- 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol
- molecular weight:
- 396.655
- Synonym(s):
- cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.
