Difference between revisions of "CPD-12853"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10939 RXN-10939] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10939 RXN-10939] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.1.3.57 EC-3.1.3.57]
+
** InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N
 +
* common name:
 +
** 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol
 +
* molecular weight:
 +
** 396.655   
 
* Synonym(s):
 
* Synonym(s):
 +
** cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[INOSITOL-1-3-4-TRIPHOSPHATE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[D-MYO-INOSITOL-34-BISPHOSPHATE]][c]
+
* [[RXN-11881]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 D-myo-inositol (1,3,4)-trisphosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 D-myo-inositol (3,4)-bisphosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-14_006130]]
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[aragem]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R03427 R03427]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986075 50986075]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
−
{{#set: ec number=EC-3.1.3.57}}
+
{{#set: inchi key=InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N}}
−
{{#set: gene associated=Ec-14_006130}}
+
{{#set: common name=4α-methyl-5α-cholesta-8,14,24-trien-3β-ol}}
−
{{#set: in pathway=}}
+
{{#set: molecular weight=396.655    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: produced by=RXN-11881}}
−
{{#set: reconstruction source=aragem}}
+

Latest revision as of 19:36, 21 March 2018

Metabolite CPD-12853

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
  • inchi key:
    • InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N
  • common name:
    • 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol
  • molecular weight:
    • 396.655
  • Synonym(s):
    • cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-12853&oldid=28103"