Difference between revisions of "SULFATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * smiles: ** C=C1(C(CC([N+])C([O-])=O)C1) * inchi key: ** InChIKey=OOJZCX...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFATE SULFATE] == * smiles: ** O=S(=O)([O-])[O-] * inchi key: ** InChIKey=QAOWNCQODCNURD-UHFF...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFATE SULFATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** O=S(=O)([O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=QAOWNCQODCNURD-UHFFFAOYSA-L |
* common name: | * common name: | ||
| − | ** | + | ** sulfate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 96.058 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** sulfuric acid |
| − | ** | + | ** H2SO4 |
| − | ** | + | ** sulphate |
| − | ** | + | ** SO4-2 |
| − | ** | + | ** SO42- |
| + | ** SO4-- | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[TransportSeed_SULFATE]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ARYLSULFAT-RXN]] | ||
| + | * [[TransportSeed_SULFATE]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[FESO3OXI-RXN]] | ||
| + | * [[SULFATE-ADENYLYLTRANS-RXN]] | ||
| + | * [[ExchangeSeed_SULFATE]] | ||
== External links == | == External links == | ||
| + | * CAS : 14808-79-8 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1117 1117] |
| − | * | + | * HMDB : HMDB01448 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00059 C00059] |
| − | * | + | * CHEMSPIDER: |
| − | {{#set: smiles= | + | ** [http://www.chemspider.com/Chemical-Structure.1085.html 1085] |
| − | {{#set: inchi key=InChIKey= | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16189 16189] |
| − | {{#set: molecular weight= | + | * METABOLIGHTS : MTBLC16189 |
| − | {{#set: common name= | + | {{#set: smiles=O=S(=O)([O-])[O-]}} |
| − | {{#set: consumed by=RXN- | + | {{#set: inchi key=InChIKey=QAOWNCQODCNURD-UHFFFAOYSA-L}} |
| + | {{#set: common name=sulfate}} | ||
| + | {{#set: molecular weight=96.058 }} | ||
| + | {{#set: common name=sulfuric acid|H2SO4|sulphate|SO4-2|SO42-|SO4--}} | ||
| + | {{#set: consumed by=TransportSeed_SULFATE}} | ||
| + | {{#set: produced by=ARYLSULFAT-RXN|TransportSeed_SULFATE}} | ||
| + | {{#set: reversible reaction associated=FESO3OXI-RXN|SULFATE-ADENYLYLTRANS-RXN|ExchangeSeed_SULFATE}} | ||
Latest revision as of 19:36, 21 March 2018
Contents
Metabolite SULFATE
- smiles:
- O=S(=O)([O-])[O-]
- inchi key:
- InChIKey=QAOWNCQODCNURD-UHFFFAOYSA-L
- common name:
- sulfate
- molecular weight:
- 96.058
- Synonym(s):
- sulfuric acid
- H2SO4
- sulphate
- SO4-2
- SO42-
- SO4--
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 14808-79-8
- PUBCHEM:
- HMDB : HMDB01448
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC16189
"O=S(=O)([O-])[O-" cannot be used as a page name in this wiki.
