Difference between revisions of "Ec-27 005790"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * smiles: ** C=C1(C(CC([N+])C([O-])=O)C1) * inchi key: ** InChIKey=OOJZCX...")
 
(Created page with "Category:Gene == Gene Ec-27_005790 == * left end position: ** 5370400 * transcription direction: ** NEGATIVE * right end position: ** 5377386 * centisome position: ** 83.2...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] ==
+
== Gene Ec-27_005790 ==
−
* smiles:
+
* left end position:
−
** C=C1(C(CC([N+])C([O-])=O)C1)
+
** 5370400
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** hypoglycin A
+
** 5377386
−
* molecular weight:
+
* centisome position:
−
** 141.169    
+
** 83.26322    
 
* Synonym(s):
 
* Synonym(s):
−
** hypoglycine
+
** Esi_0000_0121
−
** hypoglycine A
+
** Esi0000_0121
−
** hypoglycin
+
−
** L-β-(methylenecyclopropyl)-alanine
+
−
** 2-amino-3-(2-methylidenecyclopropyl)propanoic acid
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-9157]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-aragem]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[ATPSYN-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7219]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5370400}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244430 25244430]
+
{{#set: transcription direction=NEGATIVE}}
−
* Wikipedia : Hypoglycin
+
{{#set: right end position=5377386}}
−
* LIGAND-CPD:
+
{{#set: centisome position=83.26322   }}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08287 C08287]
+
{{#set: common name=Esi_0000_0121|Esi0000_0121}}
−
* HMDB : HMDB29427
+
{{#set: reaction associated=ATPASE-RXN|ATPSYN-RXN}}
−
{{#set: smiles=C=C1(C(CC([N+])C([O-])=O)C1)}}
+
{{#set: pathway associated=PWY-7219}}
−
{{#set: inchi key=InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N}}
+
−
{{#set: common name=hypoglycin A}}
+
−
{{#set: molecular weight=141.169   }}
+
−
{{#set: common name=hypoglycine|hypoglycine A|hypoglycin|L-β-(methylenecyclopropyl)-alanine|2-amino-3-(2-methylidenecyclopropyl)propanoic acid}}
+
−
{{#set: consumed by=RXN-9157}}
+

Latest revision as of 20:36, 21 March 2018

Gene Ec-27_005790

  • left end position:
    • 5370400
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5377386
  • centisome position:
    • 83.26322
  • Synonym(s):
    • Esi_0000_0121
    • Esi0000_0121

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_005790&oldid=28149"