Difference between revisions of "Ec-27 005790"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * smiles: ** C=C1(C(CC([N+])C([O-])=O)C1) * inchi key: ** InChIKey=OOJZCX...") |
(Created page with "Category:Gene == Gene Ec-27_005790 == * left end position: ** 5370400 * transcription direction: ** NEGATIVE * right end position: ** 5377386 * centisome position: ** 83.2...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-27_005790 == |
− | * | + | * left end position: |
− | ** | + | ** 5370400 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5377386 |
− | * | + | * centisome position: |
− | ** | + | ** 83.26322 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0000_0121 |
− | ** | + | ** Esi0000_0121 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[ATPASE-RXN]] |
− | + | ** Source: [[orthology-aragem]] | |
− | == | + | * Reaction: [[ATPSYN-RXN]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7219]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5370400}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5377386}} | |
− | + | {{#set: centisome position=83.26322 }} | |
− | + | {{#set: common name=Esi_0000_0121|Esi0000_0121}} | |
− | + | {{#set: reaction associated=ATPASE-RXN|ATPSYN-RXN}} | |
− | {{#set: | + | {{#set: pathway associated=PWY-7219}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:36, 21 March 2018
Gene Ec-27_005790
- left end position:
- 5370400
- transcription direction:
- NEGATIVE
- right end position:
- 5377386
- centisome position:
- 83.26322
- Synonym(s):
- Esi_0000_0121
- Esi0000_0121
Reactions associated
- Reaction: ATPASE-RXN
- Source: orthology-aragem
- Reaction: ATPSYN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome