Difference between revisions of "Ec-01 003690"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SEROTONIN SEROTONIN] == * smiles: ** C1(=C(CC[N+])C2(C=C(O)C=CC(N1)=2)) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Ec-01_003690 == * left end position: ** 3074371 * transcription direction: ** POSITIVE * right end position: ** 3076570 * centisome position: ** 29.7...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_003690 == |
− | * | + | * left end position: |
− | ** | + | ** 3074371 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3076570 |
− | * | + | * centisome position: |
− | ** | + | ** 29.793783 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0003_0298 |
− | ** | + | ** Esi0003_0298 |
− | ** | + | ** AAA ATPase delet |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[ATPASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | * Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN-12195]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN-12196]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN0-5462]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7210]] | ||
+ | * [[PWY-7198]] | ||
+ | * [[PWY-6545]] | ||
+ | * [[PWY-7184]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3074371}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3076570}} | |
− | + | {{#set: centisome position=29.793783 }} | |
− | + | {{#set: common name=Esi_0003_0298|Esi0003_0298|AAA ATPase delet}} | |
− | + | {{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}} | |
− | + | {{#set: pathway associated=PWY-7210|PWY-7198|PWY-6545|PWY-7184}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:36, 21 March 2018
Gene Ec-01_003690
- left end position:
- 3074371
- transcription direction:
- POSITIVE
- right end position:
- 3076570
- centisome position:
- 29.793783
- Synonym(s):
- Esi_0003_0298
- Esi0003_0298
- AAA ATPase delet
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: NUCLEOSIDE-TRIPHOSPHATASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-12195
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-12196
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN0-5462
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome