Difference between revisions of "CPD-709"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.27.1-RXN 3.1.27.1-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ribonuclease T2 * ec...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2C...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.27.1-RXN 3.1.27.1-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N
 
* common name:
 
* common name:
** ribonuclease T2
+
** (5α)-campestan-3-one
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/3.1.27.1 EC-3.1.27.1]
+
** 400.687   
 
* Synonym(s):
 
* Synonym(s):
 +
** methylcholestanone
 +
** (24R)-24-methyl-5α-cholestan-3-one
 +
** 3-dehydro-campestanol
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[WATER]][c] '''+''' 1 [[RNA-Holder]][c] '''=>''' 1 [[3-Prime-Ribonucleoside-Monophosphates]][c] '''+''' 1 [[3-phosphooligonucleotides]][c]
+
* [[RXN-711]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 H2O[c] '''+''' 1 RNA[c] '''=>''' 1 a ribonucleoside 3'-phosphate[c] '''+''' 1 a 3' phosphooligonucleotide[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* Gene: [[Ec-03_004910]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: GO-TERM
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* UNIPROT:
+
* PUBCHEM:
** [http://www.uniprot.org/uniprot/Q7M439 Q7M439]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201374 25201374]
** [http://www.uniprot.org/uniprot/Q7M329 Q7M329]
+
* LIGAND-CPD:
** [http://www.uniprot.org/uniprot/Q7M330 Q7M330]
+
** [http://www.genome.jp/dbget-bin/www_bget?C15786 C15786]
** [http://www.uniprot.org/uniprot/P10281 P10281]
+
* HMDB : HMDB12116
** [http://www.uniprot.org/uniprot/P00649 P00649]
+
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N}}
{{#set: common name=ribonuclease T2}}
+
{{#set: common name=(5α)-campestan-3-one}}
{{#set: ec number=EC-3.1.27.1}}
+
{{#set: molecular weight=400.687    }}
{{#set: gene associated=Ec-03_004910}}
+
{{#set: common name=methylcholestanone|(24R)-24-methyl-5α-cholestan-3-one|3-dehydro-campestanol}}
{{#set: in pathway=}}
+
{{#set: produced by=RXN-711}}
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 20:36, 21 March 2018

Metabolite CPD-709

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N
  • common name:
    • (5α)-campestan-3-one
  • molecular weight:
    • 400.687
  • Synonym(s):
    • methylcholestanone
    • (24R)-24-methyl-5α-cholestan-3-one
    • 3-dehydro-campestanol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.