Difference between revisions of "CPD-37"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-08_000710 == * left end position: ** 721881 * transcription direction: ** POSITIVE * right end position: ** 726514 * centisome position: ** 10.779...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-37 CPD-37] == * smiles: ** [CH](=O)C(O)C(O)CC(=O)C(=O)[O-] * inchi key: ** InChIKey=IMUGYKF...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-37 CPD-37] == |
| − | * | + | * smiles: |
| − | ** | + | ** [CH](=O)C(O)C(O)CC(=O)C(=O)[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=IMUGYKFHMJLTOU-UCORVYFPSA-M |
| − | * | + | * common name: |
| − | ** | + | ** 5-dehydro-4-deoxy-D-glucuronate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 175.118 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 4-deoxy-L-threo-5-hexosulose uronate |
| − | ** | + | ** 4,5-dihydroxy-2,6-dioxo-hexanoate |
| + | ** (4S,5R)-4,5-dihydroxy-2,6-dioxohexanoate | ||
| + | ** 5-keto-4-deoxyuronate | ||
| + | ** DKI | ||
| + | ** 4-deoxy-5-ketouronic acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-16475]] | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9548606 9548606] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.7827529.html 7827529] |
| − | {{#set: common name= | + | * CHEBI: |
| − | {{#set: reaction associated= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17117 17117] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04053 C04053] | ||
| + | {{#set: smiles=[CH](=O)C(O)C(O)CC(=O)C(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=IMUGYKFHMJLTOU-UCORVYFPSA-M}} | ||
| + | {{#set: common name=5-dehydro-4-deoxy-D-glucuronate}} | ||
| + | {{#set: molecular weight=175.118 }} | ||
| + | {{#set: common name=4-deoxy-L-threo-5-hexosulose uronate|4,5-dihydroxy-2,6-dioxo-hexanoate|(4S,5R)-4,5-dihydroxy-2,6-dioxohexanoate|5-keto-4-deoxyuronate|DKI|4-deoxy-5-ketouronic acid}} | ||
| + | {{#set: reversible reaction associated=RXN-16475}} | ||
Latest revision as of 19:37, 21 March 2018
Contents
Metabolite CPD-37
- smiles:
- [CH](=O)C(O)C(O)CC(=O)C(=O)[O-]
- inchi key:
- InChIKey=IMUGYKFHMJLTOU-UCORVYFPSA-M
- common name:
- 5-dehydro-4-deoxy-D-glucuronate
- molecular weight:
- 175.118
- Synonym(s):
- 4-deoxy-L-threo-5-hexosulose uronate
- 4,5-dihydroxy-2,6-dioxo-hexanoate
- (4S,5R)-4,5-dihydroxy-2,6-dioxohexanoate
- 5-keto-4-deoxyuronate
- DKI
- 4-deoxy-5-ketouronic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)CC(=O)C(=O)[O-" cannot be used as a page name in this wiki.
