Difference between revisions of "CPD-499"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Acylglycero-Phosphocholines 2-Acylglycero-Phosphocholines] == * common name: ** a 2-acyl 1-ly...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] == * smiles: ** CC(O)(CCOP(=O)([O-])[O-])CC(=O)[O-] * inchi key: ** InChIKey=O...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] == |
| + | * smiles: | ||
| + | ** CC(O)(CCOP(=O)([O-])[O-])CC(=O)[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=OKZYCXHTTZZYSK-ZCFIWIBFSA-K | ||
* common name: | * common name: | ||
| − | ** | + | ** (R)-mevalonate 5-phosphate |
| + | * molecular weight: | ||
| + | ** 225.115 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (R)-5-phosphomevalonic acid |
| − | ** | + | ** mevalonate-5P |
| − | ** | + | ** (R)-5-phosphomevalonate |
| − | ** | + | ** (R)-mevalonic acid 5-phosphate |
| − | + | ** mevalonate-P | |
| − | ** | + | |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[MEVALONATE-KINASE-RXN]] | ||
| + | * [[PHOSPHOMEVALONATE-KINASE-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 73566-35-5 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244548 25244548] |
| + | * HMDB : HMDB01343 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01107 C01107] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58146 58146] | ||
| + | * METABOLIGHTS : MTBLC58146 | ||
| + | {{#set: smiles=CC(O)(CCOP(=O)([O-])[O-])CC(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=OKZYCXHTTZZYSK-ZCFIWIBFSA-K}} | ||
| + | {{#set: common name=(R)-mevalonate 5-phosphate}} | ||
| + | {{#set: molecular weight=225.115 }} | ||
| + | {{#set: common name=(R)-5-phosphomevalonic acid|mevalonate-5P|(R)-5-phosphomevalonate|(R)-mevalonic acid 5-phosphate|mevalonate-P}} | ||
| + | {{#set: reversible reaction associated=MEVALONATE-KINASE-RXN|PHOSPHOMEVALONATE-KINASE-RXN}} | ||
Latest revision as of 19:37, 21 March 2018
Contents
Metabolite CPD-499
- smiles:
- CC(O)(CCOP(=O)([O-])[O-])CC(=O)[O-]
- inchi key:
- InChIKey=OKZYCXHTTZZYSK-ZCFIWIBFSA-K
- common name:
- (R)-mevalonate 5-phosphate
- molecular weight:
- 225.115
- Synonym(s):
- (R)-5-phosphomevalonic acid
- mevalonate-5P
- (R)-5-phosphomevalonate
- (R)-mevalonic acid 5-phosphate
- mevalonate-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 73566-35-5
- PUBCHEM:
- HMDB : HMDB01343
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58146
"CC(O)(CCOP(=O)([O-])[O-])CC(=O)[O-" cannot be used as a page name in this wiki.
