Difference between revisions of "Ec-22 000860"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([...")
(Created page with "Category:Gene == Gene Ec-22_000860 == * left end position: ** 999973 * transcription direction: ** POSITIVE * right end position: ** 1006566 * centisome position: ** 22.14...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] ==
+
== Gene Ec-22_000860 ==
−
* smiles:
+
* left end position:
−
** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O
+
** 999973
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4-hydroxy-2-nonenal-glutathione conjugate
+
** 1006566
−
* molecular weight:
+
* centisome position:
−
** 462.537    
+
** 22.143623    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0065_0096
 +
** Esi0065_0096
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
* [[RXN-13673]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=999973}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657725 90657725]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O}}
+
{{#set: right end position=1006566}}
−
{{#set: inchi key=InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M}}
+
{{#set: centisome position=22.143623    }}
−
{{#set: common name=4-hydroxy-2-nonenal-glutathione conjugate}}
+
{{#set: common name=Esi_0065_0096|Esi0065_0096}}
−
{{#set: molecular weight=462.537    }}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
{{#set: produced by=RXN-13673}}
+

Latest revision as of 19:37, 21 March 2018

Gene Ec-22_000860

  • left end position:
    • 999973
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1006566
  • centisome position:
    • 22.143623
  • Synonym(s):
    • Esi_0065_0096
    • Esi0065_0096

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-22_000860&oldid=28192"