Difference between revisions of "2.1.1.72-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCARATE D-GLUCARATE] == * smiles: ** C(=O)(C(O)C(O)C(O)C(O)C(=O)[O-])[O-] * inchi key: ** I...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.72-RXN 2.1.1.72-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** EsV-1-129 * ec number...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.72-RXN 2.1.1.72-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** EsV-1-129 |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.1.1.72 EC-2.1.1.72] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[DNA-Adenines]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[DNA-6-Methyl-Amino-Purines]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] |
− | * [[ | + | * With common name(s): |
+ | ** | ||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-06_005560]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02961 R02961] |
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/Q7B7V5 Q7B7V5] |
− | * | + | ** [http://www.uniprot.org/uniprot/P44414 P44414] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q57168 Q57168] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9PIS1 Q9PIS1] |
− | * | + | ** [http://www.uniprot.org/uniprot/P44431 P44431] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P95510 P95510] |
− | * | + | ** [http://www.uniprot.org/uniprot/P29749 P29749] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P14385 P14385] |
− | * | + | ** [http://www.uniprot.org/uniprot/P43422 P43422] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q47911 Q47911] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P21311 P21311] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P14751 P14751] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P14827 P14827] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P25240 P25240] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P25239 P25239] |
+ | ** [http://www.uniprot.org/uniprot/P29538 P29538] | ||
+ | ** [http://www.uniprot.org/uniprot/Q03055 Q03055] | ||
+ | ** [http://www.uniprot.org/uniprot/Q51829 Q51829] | ||
+ | ** [http://www.uniprot.org/uniprot/P25238 P25238] | ||
+ | ** [http://www.uniprot.org/uniprot/P35516 P35516] | ||
+ | ** [http://www.uniprot.org/uniprot/P33563 P33563] | ||
+ | ** [http://www.uniprot.org/uniprot/P43641 P43641] | ||
+ | ** [http://www.uniprot.org/uniprot/P45454 P45454] | ||
+ | ** [http://www.uniprot.org/uniprot/P50193 P50193] | ||
+ | ** [http://www.uniprot.org/uniprot/Q56004 Q56004] | ||
+ | ** [http://www.uniprot.org/uniprot/P73682 P73682] | ||
+ | ** [http://www.uniprot.org/uniprot/P31118 P31118] | ||
+ | ** [http://www.uniprot.org/uniprot/O41063 O41063] | ||
+ | ** [http://www.uniprot.org/uniprot/P12427 P12427] | ||
+ | ** [http://www.uniprot.org/uniprot/P04392 P04392] | ||
+ | ** [http://www.uniprot.org/uniprot/P0AEE8 P0AEE8] | ||
+ | ** [http://www.uniprot.org/uniprot/P08957 P08957] | ||
+ | ** [http://www.uniprot.org/uniprot/P00472 P00472] | ||
+ | ** [http://www.uniprot.org/uniprot/P04393 P04393] | ||
+ | ** [http://www.uniprot.org/uniprot/P00473 P00473] | ||
+ | ** [http://www.uniprot.org/uniprot/P24582 P24582] | ||
+ | ** [http://www.uniprot.org/uniprot/P00474 P00474] | ||
+ | ** [http://www.uniprot.org/uniprot/P04043 P04043] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=EsV-1-129}} | ||
+ | {{#set: ec number=EC-2.1.1.72}} | ||
+ | {{#set: gene associated=Ec-06_005560}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:37, 21 March 2018
Contents
Reaction 2.1.1.72-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- EsV-1-129
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 DNA-Adenines[c] + 1 S-ADENOSYLMETHIONINE[c] => 1 DNA-6-Methyl-Amino-Purines[c] + 1 ADENOSYL-HOMO-CYS[c] + 1 PROTON[c]
- With common name(s):
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-06_005560
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- LIGAND-RXN:
- UNIPROT: