Difference between revisions of "RXN-12507"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-]...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12507 RXN-12507] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12507 RXN-12507] ==
* smiles:
+
* direction:
** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L
+
* common name:
+
** α,α-trehalose 6-phosphate
+
* molecular weight:
+
** 420.263   
+
 
* Synonym(s):
 
* Synonym(s):
** α,α-D-trehalose 6-phosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[TREHALOSEPHOSPHA-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD0-2171]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[CPD-10284]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c]
* [[TREHALOSE6PSYN-RXN]]
+
* With common name(s):
* [[2.4.1.36-RXN]]
+
** 1 (S)-3-hydroxytetradecanoyl-CoA[c] '''+''' 1 NAD+[c] '''=>''' 1 3-oxo-myristoyl-CoA[c] '''+''' 1 H+[c] '''+''' 1 NADH[c]
== Reaction(s) of unknown directionality ==
+
 
* [[RXN-761]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-14_006530]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-7654]], (8E,10E)-dodeca-8,10-dienol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7654 PWY-7654]
 +
** '''5''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 4484-88-2
+
* RHEA:
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31168 31168]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246105 25246105]
+
* LIGAND-RXN:
* HMDB : HMDB01124
+
** [http://www.genome.jp/dbget-bin/www_bget?R04739 R04739]
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.genome.jp/dbget-bin/www_bget?C00689 C00689]
+
{{#set: gene associated=Ec-14_006530}}
* CHEBI:
+
{{#set: in pathway=PWY-7654}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58429 58429]
+
{{#set: reconstruction category=orthology|annotation}}
* BIGG : 35708
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: inchi key=InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L}}
+
{{#set: common name=α,α-trehalose 6-phosphate}}
+
{{#set: molecular weight=420.263    }}
+
{{#set: common name=α,α-D-trehalose 6-phosphate}}
+
{{#set: consumed by=TREHALOSEPHOSPHA-RXN}}
+
{{#set: produced by=TREHALOSE6PSYN-RXN|2.4.1.36-RXN}}
+
{{#set: consumed or produced by=RXN-761}}
+

Latest revision as of 20:37, 21 March 2018

Reaction RXN-12507

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 (S)-3-hydroxytetradecanoyl-CoA[c] + 1 NAD+[c] => 1 3-oxo-myristoyl-CoA[c] + 1 H+[c] + 1 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7654, (8E,10E)-dodeca-8,10-dienol biosynthesis: PWY-7654
    • 5 reactions found over 11 reactions in the full pathway

Reconstruction information

External links