Difference between revisions of "RXN-14971"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))O * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14971 RXN-14971] == * direction: ** LEFT-TO-RIGHT * common name: ** Succinate dehydrogenase/fum...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14971 RXN-14971] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain |
− | * | + | ** SDH1, succinate dehydrogenase subunit 1 |
− | ** | + | ** SDH3, succinate dehydrogenase subunit 3 |
+ | ** SDH2, succinate dehydrogenase subunit 2 | ||
+ | ** SDH4, succinate dehydrogenase subunit 4 | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/1.3.5.1 EC-1.3.5.1] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[ETR-Quinones]][c] '''+''' 1 [[SUC]][c] '''=>''' 1 [[ETR-Quinols]][c] '''+''' 1 [[FUM]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 an electron-transfer quinone[c] '''+''' 1 succinate[c] '''=>''' 1 an electron-transfer quinol[c] '''+''' 1 fumarate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-05_003640]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-21_003470]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-07_002870]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-11_000360]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-27_006560]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-07_007310]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7254]], TCA cycle VII (acetate-producers): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7254 PWY-7254] | ||
+ | ** '''7''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[P105-PWY]], TCA cycle IV (2-oxoglutarate decarboxylase): [http://metacyc.org/META/NEW-IMAGE?object=P105-PWY P105-PWY] | ||
+ | ** '''9''' reactions found over '''11''' reactions in the full pathway | ||
+ | * [[PWY-6969]], TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6969 PWY-6969] | ||
+ | ** '''10''' reactions found over '''12''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain}} | |
− | + | {{#set: common name=SDH1, succinate dehydrogenase subunit 1}} | |
− | + | {{#set: common name=SDH3, succinate dehydrogenase subunit 3}} | |
− | + | {{#set: common name=SDH2, succinate dehydrogenase subunit 2}} | |
− | + | {{#set: common name=SDH4, succinate dehydrogenase subunit 4}} | |
− | + | {{#set: ec number=EC-1.3.5.1}} | |
− | + | {{#set: gene associated=Ec-05_003640|Ec-21_003470|Ec-07_002870|Ec-11_000360|Ec-27_006560|Ec-07_007310}} | |
− | + | {{#set: in pathway=PWY-7254|P105-PWY|PWY-6969}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:37, 21 March 2018
Contents
Reaction RXN-14971
- direction:
- LEFT-TO-RIGHT
- common name:
- Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain
- SDH1, succinate dehydrogenase subunit 1
- SDH3, succinate dehydrogenase subunit 3
- SDH2, succinate dehydrogenase subunit 2
- SDH4, succinate dehydrogenase subunit 4
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ETR-Quinones[c] + 1 SUC[c] => 1 ETR-Quinols[c] + 1 FUM[c]
- With common name(s):
- 1 an electron-transfer quinone[c] + 1 succinate[c] => 1 an electron-transfer quinol[c] + 1 fumarate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-05_003640
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-21_003470
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-07_002870
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-11_000360
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-27_006560
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-07_007310
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- PWY-7254, TCA cycle VII (acetate-producers): PWY-7254
- 7 reactions found over 9 reactions in the full pathway
- P105-PWY, TCA cycle IV (2-oxoglutarate decarboxylase): P105-PWY
- 9 reactions found over 11 reactions in the full pathway
- PWY-6969, TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase): PWY-6969
- 10 reactions found over 12 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome