Difference between revisions of "PROTOHEME"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8281 RXN-8281] == * direction: ** LEFT-TO-RIGHT * common name: ** Galactosyl transferase * ec n...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] == * smiles: ** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8281 RXN-8281] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))
 +
* inchi key:
 +
** InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J
 
* common name:
 
* common name:
−
** Galactosyl transferase
+
** ferroheme b
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.4.1 EC-2.4.1]
+
** 614.482   
 
* Synonym(s):
 
* Synonym(s):
 +
** protoheme IX
 +
** ferroprotoporphyrin IX
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-458]][c] '''+''' 1 [[4-METHYL-MYO-INOSITOL]][c] '''=>''' 1 [[MYO-INOSITOL]][c] '''+''' 1 [[CPD-8058]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[PROTOHEMEFERROCHELAT-RXN]]
−
** 1 galactinol[c] '''+''' 1 D-ononitol[c] '''=>''' 1 myo-inositol[c] '''+''' 1 D-galactosylononitol[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-10_001650]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-5338]], galactosylcyclitol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5338 PWY-5338]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=Galactosyl transferase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17627 17627]
−
{{#set: ec number=EC-2.4.1}}
+
{{#set: smiles=C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))}}
−
{{#set: gene associated=Ec-10_001650}}
+
{{#set: inchi key=InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J}}
−
{{#set: in pathway=PWY-5338}}
+
{{#set: common name=ferroheme b}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=614.482    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=protoheme IX|ferroprotoporphyrin IX}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: reversible reaction associated=PROTOHEMEFERROCHELAT-RXN}}

Latest revision as of 19:37, 21 March 2018

Metabolite PROTOHEME

  • smiles:
    • C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))
  • inchi key:
    • InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J
  • common name:
    • ferroheme b
  • molecular weight:
    • 614.482
  • Synonym(s):
    • protoheme IX
    • ferroprotoporphyrin IX

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PROTOHEME&oldid=28242"