Difference between revisions of "RXN0-6359"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * smiles: ** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=B...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6359 RXN0-6359] == * direction: ** LEFT-TO-RIGHT * common name: ** thiosulfate sulfurtransfera...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6359 RXN0-6359] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** thiosulfate sulfurtransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.8.1.1 EC-2.8.1.1] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[Sulfurated-Sulfur-Acceptors]][c] '''+''' 1 [[HCN]][c] '''=>''' 1 [[HSCN]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Unsulfurated-Sulfur-Acceptors]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a sulfurated [sulfur carrier][c] '''+''' 1 hydrogen cyanide[c] '''=>''' 1 thiocyanate[c] '''+''' 1 H+[c] '''+''' 1 an unsulfurated [sulfur carrier][c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-22_001610]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-16_003300]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=thiosulfate sulfurtransferase}} | |
− | + | {{#set: ec number=EC-2.8.1.1}} | |
− | {{#set: | + | {{#set: gene associated=Ec-22_001610|Ec-16_003300}} |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:37, 21 March 2018
Contents
Reaction RXN0-6359
- direction:
- LEFT-TO-RIGHT
- common name:
- thiosulfate sulfurtransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Sulfurated-Sulfur-Acceptors[c] + 1 HCN[c] => 1 HSCN[c] + 1 PROTON[c] + 1 Unsulfurated-Sulfur-Acceptors[c]
- With common name(s):
- 1 a sulfurated [sulfur carrier][c] + 1 hydrogen cyanide[c] => 1 thiocyanate[c] + 1 H+[c] + 1 an unsulfurated [sulfur carrier][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-22_001610
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-16_003300
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome