Difference between revisions of "CPD-3187"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12507 RXN-12507] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * smiles: ** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=B...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2)) |
| + | * inchi key: | ||
| + | ** InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O | ||
| + | * common name: | ||
| + | ** 2'-hydroxynicotine | ||
| + | * molecular weight: | ||
| + | ** 179.241 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-146]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245599 25245599] |
| − | * | + | * HMDB : HMDB01329 |
| − | + | {{#set: smiles=C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))}} | |
| − | {{#set: | + | {{#set: inchi key=InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O}} |
| − | {{#set: | + | {{#set: common name=2'-hydroxynicotine}} |
| − | {{#set: | + | {{#set: molecular weight=179.241 }} |
| − | {{#set: | + | {{#set: produced by=RXN66-146}} |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 20:37, 21 March 2018
Contents
Metabolite CPD-3187
- smiles:
- C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))
- inchi key:
- InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O
- common name:
- 2'-hydroxynicotine
- molecular weight:
- 179.241
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB01329
"C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))" cannot be used as a page name in this wiki.
