Difference between revisions of "CPD-17372"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14384 RXN-14384] == * direction: ** LEFT-TO-RIGHT * common name: ** Aminotransferase class V do...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O * inchi...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14384 RXN-14384] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O
 +
* inchi key:
 +
** InChIKey=GFJKJLHWWZXDAU-KXFGNQBASA-L
 
* common name:
 
* common name:
** Aminotransferase class V domain
+
** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate
** Cysteine desulfurase
+
* molecular weight:
* ec number:
+
** 450.508   
** [http://enzyme.expasy.org/EC/2.8.1.7 EC-2.8.1.7]
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-16118]]
** 1 [[S-CD-Apo-SP-Complex]][c] '''=>''' 1 [[CD-S-SP-Complex]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-16117]]
** 1 an S-sulfanyl-[cysteine desulfurase]-[disordered-form scaffold protein] complex[c] '''=>''' 1 a [cysteine desulfurase]-S-sulfanyl-[disordered-form scaffold protein] complex[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-22_000950]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
* [[Ec-21_005640]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
* [[Ec-21_003740]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
== Pathways  ==
+
* [[PWY-7250]], [2Fe-2S] iron-sulfur cluster biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7250 PWY-7250]
+
** '''10''' reactions found over '''10''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=Aminotransferase class V domain}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820233 91820233]
{{#set: common name=Cysteine desulfurase}}
+
{{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O}}
{{#set: ec number=EC-2.8.1.7}}
+
{{#set: inchi key=InChIKey=GFJKJLHWWZXDAU-KXFGNQBASA-L}}
{{#set: gene associated=Ec-22_000950|Ec-21_005640|Ec-21_003740}}
+
{{#set: common name=1-[18-hydroxyoleyl]-2-lyso-phosphatidate}}
{{#set: in pathway=PWY-7250}}
+
{{#set: molecular weight=450.508    }}
{{#set: reconstruction category=annotation}}
+
{{#set: consumed by=RXN-16118}}
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: produced by=RXN-16117}}
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 20:38, 21 March 2018

Metabolite CPD-17372

  • smiles:
    • C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O
  • inchi key:
    • InChIKey=GFJKJLHWWZXDAU-KXFGNQBASA-L
  • common name:
    • 1-[18-hydroxyoleyl]-2-lyso-phosphatidate
  • molecular weight:
    • 450.508
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O" cannot be used as a page name in this wiki.
"1-[18-hydroxyoleyl]-2-lyso-phosphatidate" cannot be used as a page name in this wiki.