Difference between revisions of "CPD-2743"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12263 RXN-12263] == * direction: ** LEFT-TO-RIGHT * common name: ** Isopentenyl-diphosphate del...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == * smiles: ** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12263 RXN-12263] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))
 +
* inchi key:
 +
** InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N
 
* common name:
 
* common name:
−
** Isopentenyl-diphosphate delta-isomerase type 1 fused to squalene synthase; probably two separate ORFs
+
** nicotine-1'-N-oxide
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.5.1.103 EC-2.5.1.103]
+
** 178.233   
 
* Synonym(s):
 
* Synonym(s):
 +
** nicotine N'-oxide
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 2 [[FARNESYL-PP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CPD-465]][c]
+
* [[RXN66-81]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 (2E,6E)-farnesyl diphosphate[c] '''=>''' 1 diphosphate[c] '''+''' 1 presqualene diphosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-11_001030]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-7072]], hopanoid biosynthesis (bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7072 PWY-7072]
+
−
** '''1''' reactions found over '''14''' reactions in the full pathway
+
−
* [[PWY-6767]], 4,4'-diapolycopenedioate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6767 PWY-6767]
+
−
** '''1''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-5875]], staphyloxanthin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5875 PWY-5875]
+
−
** '''1''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-6105]], botryococcenes and methylated squalene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6105 PWY-6105]
+
−
** '''2''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00702 R00702]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68107 68107]
−
* UNIPROT:
+
* CHEMSPIDER:
−
** [http://www.uniprot.org/uniprot/O69445 O69445]
+
** [http://www.chemspider.com/Chemical-Structure.61415.html 61415]
−
** [http://www.uniprot.org/uniprot/P36596 P36596]
+
* HMDB : HMDB01497
−
** [http://www.uniprot.org/uniprot/O65688 O65688]
+
{{#set: smiles=C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))}}
−
** [http://www.uniprot.org/uniprot/O23118 O23118]
+
{{#set: inchi key=InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N}}
−
** [http://www.uniprot.org/uniprot/O22107 O22107]
+
{{#set: common name=nicotine-1'-N-oxide}}
−
** [http://www.uniprot.org/uniprot/Q40472 Q40472]
+
{{#set: molecular weight=178.233    }}
−
** [http://www.uniprot.org/uniprot/O22106 O22106]
+
{{#set: common name=nicotine N'-oxide}}
−
** [http://www.uniprot.org/uniprot/P53800 P53800]
+
{{#set: produced by=RXN66-81}}
−
** [http://www.uniprot.org/uniprot/P53799 P53799]
+
−
** [http://www.uniprot.org/uniprot/P53798 P53798]
+
−
** [http://www.uniprot.org/uniprot/P29704 P29704]
+
−
** [http://www.uniprot.org/uniprot/Q04903 Q04903]
+
−
** [http://www.uniprot.org/uniprot/Q42761 Q42761]
+
−
** [http://www.uniprot.org/uniprot/Q42760 Q42760]
+
−
** [http://www.uniprot.org/uniprot/P37268 P37268]
+
−
** [http://www.uniprot.org/uniprot/Q02769 Q02769]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: common name=Isopentenyl-diphosphate delta-isomerase type 1 fused to squalene synthase; probably two separate ORFs}}
+
−
{{#set: ec number=EC-2.5.1.103}}
+
−
{{#set: gene associated=Ec-11_001030}}
+
−
{{#set: in pathway=PWY-7072|PWY-6767|PWY-5875|PWY-6105}}
+
−
{{#set: reconstruction category=orthology|annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 19:38, 21 March 2018

Metabolite CPD-2743

  • smiles:
    • C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))
  • inchi key:
    • InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N
  • common name:
    • nicotine-1'-N-oxide
  • molecular weight:
    • 178.233
  • Synonym(s):
    • nicotine N'-oxide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • CHEMSPIDER:
  • HMDB : HMDB01497
"C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-2743&oldid=28328"