Difference between revisions of "THIOREDOXIN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * inchi key: ** InChIKey=WEZ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIOREDOXIN-RXN THIOREDOXIN-RXN] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formul...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIOREDOXIN-RXN THIOREDOXIN-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[Acceptor]][c] '''+''' 1 [[Red-Thioredoxin]][c] '''=>''' 1 [[Donor-H2]][c] '''+''' 1 [[Ox-Thioredoxin]][c] |
− | == | + | * With common name(s): |
+ | ** 1 an oxidized unknown electron acceptor[c] '''+''' 1 a reduced thioredoxin[c] '''=>''' 1 an reduced unknown electron acceptor[c] '''+''' 1 an oxidized thioredoxin[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[THIOREDOX-PWY]], thioredoxin pathway: [http://metacyc.org/META/NEW-IMAGE?object=THIOREDOX-PWY THIOREDOX-PWY] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: in pathway=THIOREDOX-PWY}} | |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:38, 21 March 2018
Contents
Reaction THIOREDOXIN-RXN
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Acceptor[c] + 1 Red-Thioredoxin[c] => 1 Donor-H2[c] + 1 Ox-Thioredoxin[c]
- With common name(s):
- 1 an oxidized unknown electron acceptor[c] + 1 a reduced thioredoxin[c] => 1 an reduced unknown electron acceptor[c] + 1 an oxidized thioredoxin[c]
Genes associated with this reaction
Pathways
- THIOREDOX-PWY, thioredoxin pathway: THIOREDOX-PWY
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome