Difference between revisions of "Ec-01 008040"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] == * smiles: ** [O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O * inchi key: ** InChIKey=U...") |
(Created page with "Category:Gene == Gene Ec-01_008040 == * left end position: ** 6908895 * transcription direction: ** POSITIVE * right end position: ** 6912893 * centisome position: ** 66.9...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_008040 == |
− | * | + | * left end position: |
− | ** | + | ** 6908895 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 6912893 |
− | * | + | * centisome position: |
− | ** | + | ** 66.954216 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0002_0064 |
− | ** | + | ** Esi0002_0064 |
− | ** | + | ** FBA1 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[F16ALDOLASE-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
− | * [[ | + | * Reaction: [[RXN-8631]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
+ | * [[PWY-1042]] | ||
+ | * [[P341-PWY]] | ||
+ | * [[PWY66-373]] | ||
+ | * [[GLUCONEO-PWY]] | ||
+ | * [[GLYCOLYSIS]] | ||
+ | * [[SUCSYN-PWY]] | ||
+ | * [[PWY-7385]] | ||
+ | * [[ANAGLYCOLYSIS-PWY]] | ||
+ | * [[CALVIN-PWY]] | ||
+ | * [[PWY-1861]] | ||
+ | * [[PWY-6142]] | ||
+ | * [[PWY-5484]] | ||
+ | * [[P185-PWY]] | ||
+ | * [[PWY66-399]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6908895}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=6912893}} | |
− | + | {{#set: centisome position=66.954216 }} | |
− | + | {{#set: common name=Esi_0002_0064|Esi0002_0064|FBA1}} | |
− | + | {{#set: reaction associated=F16ALDOLASE-RXN|RXN-8631}} | |
− | + | {{#set: pathway associated=PWY-1042|P341-PWY|PWY66-373|GLUCONEO-PWY|GLYCOLYSIS|SUCSYN-PWY|PWY-7385|ANAGLYCOLYSIS-PWY|CALVIN-PWY|PWY-1861|PWY-6142|PWY-5484|P185-PWY|PWY66-399}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:38, 21 March 2018
Gene Ec-01_008040
- left end position:
- 6908895
- transcription direction:
- POSITIVE
- right end position:
- 6912893
- centisome position:
- 66.954216
- Synonym(s):
- Esi_0002_0064
- Esi0002_0064
- FBA1
Reactions associated
- Reaction: F16ALDOLASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-8631
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
Pathways associated
- PWY-1042
- P341-PWY
- PWY66-373
- GLUCONEO-PWY
- GLYCOLYSIS
- SUCSYN-PWY
- PWY-7385
- ANAGLYCOLYSIS-PWY
- CALVIN-PWY
- PWY-1861
- PWY-6142
- PWY-5484
- P185-PWY
- PWY66-399