Difference between revisions of "DIHYDRONEOPTERIN-P"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-11_002530 == * left end position: ** 2652481 * transcription direction: ** NEGATIVE * right end position: ** 2660149 * centisome position: ** 42.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRONEOPTERIN-P DIHYDRONEOPTERIN-P] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRONEOPTERIN-P DIHYDRONEOPTERIN-P] == |
− | * | + | * smiles: |
− | ** | + | ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2)) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=PLSQMGZYOGSOCE-XINAWCOVSA-L |
− | * | + | * common name: |
− | ** | + | ** 7,8-dihydroneopterin 3'-phosphate |
− | * | + | * molecular weight: |
− | ** | + | ** 333.197 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** dihydroneopterin 3'-monophosphate |
− | ** | + | ** dihydroneopterin-P |
+ | ** 2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine phosphate | ||
+ | ** dihydroneopterin 3'-phosphate | ||
+ | ** 7,8-dihydro-D-neopterin 3'-phosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05925 C05925] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58762 58762] |
− | {{#set: common name= | + | * BIGG : 1447045 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245170 25245170] |
+ | * HMDB : HMDB06824 | ||
+ | {{#set: smiles=C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2))}} | ||
+ | {{#set: inchi key=InChIKey=PLSQMGZYOGSOCE-XINAWCOVSA-L}} | ||
+ | {{#set: common name=7,8-dihydroneopterin 3'-phosphate}} | ||
+ | {{#set: molecular weight=333.197 }} | ||
+ | {{#set: common name=dihydroneopterin 3'-monophosphate|dihydroneopterin-P|2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine phosphate|dihydroneopterin 3'-phosphate|7,8-dihydro-D-neopterin 3'-phosphate}} | ||
+ | {{#set: consumed by=DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN}} | ||
+ | {{#set: produced by=H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN}} |
Latest revision as of 20:38, 21 March 2018
Contents
Metabolite DIHYDRONEOPTERIN-P
- smiles:
- C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2))
- inchi key:
- InChIKey=PLSQMGZYOGSOCE-XINAWCOVSA-L
- common name:
- 7,8-dihydroneopterin 3'-phosphate
- molecular weight:
- 333.197
- Synonym(s):
- dihydroneopterin 3'-monophosphate
- dihydroneopterin-P
- 2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine phosphate
- dihydroneopterin 3'-phosphate
- 7,8-dihydro-D-neopterin 3'-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2))" cannot be used as a page name in this wiki.