Difference between revisions of "DIAMINONONANOATE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-01_008040 == * left end position: ** 6908895 * transcription direction: ** POSITIVE * right end position: ** 6912893 * centisome position: ** 66.9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINONONANOATE DIAMINONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)[N+])[N+] * inchi key: *...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINONONANOATE DIAMINONONANOATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C(CCCCCC([O-])=O)[N+])[N+] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=KCEGBPIYGIWCDH-UHFFFAOYSA-O |
| − | * | + | * common name: |
| − | ** | + | ** 7,8-diaminopelargonate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 189.277 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 7,8-diaminononanoate |
| − | ** | + | ** DAPA |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[DETHIOBIOTIN-SYN-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[DAPASYN-RXN]] | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245451 25245451] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58500 58500] |
| − | {{#set: common name= | + | * BIGG : 36673 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01037 C01037] |
| + | {{#set: smiles=CC(C(CCCCCC([O-])=O)[N+])[N+]}} | ||
| + | {{#set: inchi key=InChIKey=KCEGBPIYGIWCDH-UHFFFAOYSA-O}} | ||
| + | {{#set: common name=7,8-diaminopelargonate}} | ||
| + | {{#set: molecular weight=189.277 }} | ||
| + | {{#set: common name=7,8-diaminononanoate|DAPA}} | ||
| + | {{#set: consumed by=DETHIOBIOTIN-SYN-RXN}} | ||
| + | {{#set: reversible reaction associated=DAPASYN-RXN}} | ||
Latest revision as of 20:38, 21 March 2018
Contents
Metabolite DIAMINONONANOATE
- smiles:
- CC(C(CCCCCC([O-])=O)[N+])[N+]
- inchi key:
- InChIKey=KCEGBPIYGIWCDH-UHFFFAOYSA-O
- common name:
- 7,8-diaminopelargonate
- molecular weight:
- 189.277
- Synonym(s):
- 7,8-diaminononanoate
- DAPA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(CCCCCC([O-])=O)[N+])[N+" cannot be used as a page name in this wiki.
